Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C290 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 40.5 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 25.6 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 21.3 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 19.7 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 19.6 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 16.3 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 15.7 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 15.7 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 15.0 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 15.0 | ||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 14.3 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 14.2 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 13.3 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 13.0 | ||||
| LDTP04032 | Glycerol-3-phosphate dehydrogenase, mitochondrial (GPD2) | 12.0 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 12.0 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 12.0 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 11.9 | ||||
| LDTP10495 | Ubiquitin carboxyl-terminal hydrolase 47 (USP47) | 11.7 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 11.5 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 11.2 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 11.1 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 10.6 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 10.3 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 10.3 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 10.3 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 10.1 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 10.1 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 9.8 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 9.6 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 9.4 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 9.2 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 9.1 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 9.1 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 8.9 | ||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | 8.9 | ||||
| LDTP04093 | Translation initiation factor IF-2, mitochondrial (MTIF2) | 8.6 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 8.5 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 8.4 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 8.3 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 8.2 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 8.2 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 8.1 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 8.1 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 8.1 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 7.8 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 7.7 | ||||
| LDTP12233 | Helicase MOV-10 (MOV10) | 7.6 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 7.1 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 7.0 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 6.9 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 6.8 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 6.8 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 6.6 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 6.5 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 6.5 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 6.4 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 6.2 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 6.1 | ||||
| LDTP01707 | Thioredoxin domain-containing protein 12 (TXNDC12) | 6.1 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 6.1 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 6.1 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 6.1 | ||||
| LDTP07504 | Lysophospholipid acyltransferase 5 (LPCAT3) | 6.1 | ||||
| LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 6.0 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 6.0 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 6.0 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 6.0 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 5.7 | ||||
| LDTP07259 | N-alpha-acetyltransferase 35, NatC auxiliary subunit (NAA35) | 5.7 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 5.7 | ||||
| LDTP08687 | tRNA (uracil-5-)-methyltransferase homolog A (TRMT2A) | 5.7 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 5.7 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 5.6 | ||||
| LDTP04253 | Alpha-aminoadipic semialdehyde dehydrogenase (ALDH7A1) | 5.4 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 5.3 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 5.2 | ||||
| LDTP05369 | Dual specificity mitogen-activated protein kinase kinase 1 (MAP2K1) | 5.0 | ||||
| LDTP03001 | E3 ubiquitin-protein ligase TRIM21 (TRIM21) | 5.0 | ||||
| LDTP04247 | Protein farnesyltransferase subunit beta (FNTB) | 5.0 | ||||
| LDTP06986 | Rab-like protein 3 (RABL3) | 5.0 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 5.0 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 5.0 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 24.3 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 23.3 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 21.3 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 21.1 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 21.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 16.3 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 15.8 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 15.0 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 14.3 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 13.5 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 12.1 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 12.0 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 11.6 | ||||
| LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 11.5 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 11.5 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 11.1 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 10.6 | ||||
| LDTP03546 | Translocator protein (TSPO) | 10.2 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 9.8 | ||||
| LDTP16163 | Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial (COX16) | 9.6 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 9.2 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 8.9 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 8.8 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 8.1 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 8.0 | ||||
| LDTP06275 | Lysosomal-associated transmembrane protein 4A (LAPTM4A) | 7.6 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 7.6 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 7.5 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 7.4 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 7.4 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 7.3 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 7.1 | ||||
| LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | 6.9 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 6.8 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 6.8 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 6.7 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 6.7 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 6.5 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 6.5 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 6.4 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 6.1 | ||||
| LDTP01160 | Peroxisomal membrane protein 11A (PEX11A) | 6.1 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 6.1 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 6.1 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 5.9 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 5.9 | ||||
| LDTP11041 | Calcium uptake protein 1, mitochondrial (MICU1) | 5.8 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 5.7 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 5.5 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 5.4 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 5.3 | ||||
| LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 5.3 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 5.3 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 5.2 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 5.2 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 5.2 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 5.1 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 5.1 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 5.1 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 4.9 | ||||
| LDTP11626 | Protein YIPF3 (YIPF3) | 4.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05160 | Nucleobindin-2 (NUCB2) | 18.6 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 17.0 | ||||
| LDTP10381 | Peroxisomal membrane protein 11C (PEX11G) | 16.6 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 15.2 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 14.9 | ||||
| LDTP08000 | Dymeclin (DYM) | 14.7 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 14.1 | ||||
| LDTP08081 | Hepatoma-derived growth factor-related protein 2 (HDGFL2) | 11.6 | ||||
| LDTP10184 | HAUS augmin-like complex subunit 1 (HAUS1) | 11.3 | ||||
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 9.1 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 9.1 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 8.6 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 8.6 | ||||
| LDTP13214 | UPF0449 protein C19orf25 (C19orf25) | 8.6 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 8.5 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 8.0 | ||||
| LDTP01075 | Protein CutA (CUTA) | 7.7 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 7.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 7.7 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 7.3 | ||||
| LDTP15714 | Mdm2-binding protein (MTBP) | 7.1 | ||||
| LDTP12746 | Gem-associated protein 8 (GEMIN8) | 7.1 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 6.9 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 6.7 | ||||
| LDTP11871 | Cobalamin trafficking protein CblD (MMADHC) | 6.6 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 6.2 | ||||
| LDTP06948 | Protein YIF1B (YIF1B) | 6.2 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 6.1 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 6.0 | ||||
| LDTP04483 | Hepatoma-derived growth factor (HDGF) | 5.9 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 5.9 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 5.8 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 5.8 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 5.5 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 5.5 | ||||
| LDTP02345 | Retinol-binding protein 1 (RBP1) | 5.4 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 5.4 | ||||
| LDTP09970 | RNA-binding protein with multiple splicing (RBPMS) | 5.1 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 5.1 | ||||
| LDTP10116 | Lipid droplet assembly factor 1 (LDAF1) | 5.0 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 5.0 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 5.0 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 4.9 | ||||
