Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C177 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 78.8 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 38.6 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 31.6 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 29.2 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 26.2 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 26.2 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 25.3 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 21.6 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 19.7 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 18.9 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 18.8 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 18.1 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 17.3 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 17.1 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 15.8 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 15.2 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 12.5 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 12.5 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 12.1 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 12.0 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 12.0 | ||||
| LDTP02640 | X-ray repair cross-complementing protein 6 (XRCC6) | 11.9 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 11.6 | ||||
| LDTP12586 | Phenylalanine--tRNA ligase beta subunit (FARSB) | 11.5 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 11.3 | ||||
| LDTP05228 | Calcium-transporting ATPase type 2C member 1 (ATP2C1) | 11.2 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 11.1 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 11.1 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 11.1 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 11.0 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 11.0 | ||||
| LDTP00975 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB (MAN1A2) | 10.9 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 10.9 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 10.8 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 10.7 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 10.5 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 10.3 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 10.2 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 10.2 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 10.0 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 9.8 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 9.6 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 9.4 | ||||
| LDTP13678 | Multiple inositol polyphosphate phosphatase 1 (MINPP1) | 9.4 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 9.1 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 9.0 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 8.9 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 8.9 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 8.9 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 8.9 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 8.8 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 8.8 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 8.8 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 8.8 | ||||
| LDTP13409 | Anaphase-promoting complex subunit 7 (ANAPC7) | 8.7 | ||||
| LDTP04327 | Cytosolic purine 5'-nucleotidase (NT5C2) | 8.7 | ||||
| LDTP08617 | Patatin-like phospholipase domain-containing protein 6 (PNPLA6) | 8.6 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 8.6 | ||||
| LDTP00836 | ATPase GET3 (GET3) | 8.5 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 8.3 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 8.3 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 8.3 | ||||
| LDTP06295 | Histone-lysine N-methyltransferase SETDB1 (SETDB1) | 8.2 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 8.2 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 8.1 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 8.1 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 8.0 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 8.0 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 7.9 | ||||
| LDTP10495 | Ubiquitin carboxyl-terminal hydrolase 47 (USP47) | 7.9 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 7.7 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 7.7 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 7.7 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 7.6 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 7.5 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 7.5 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 7.5 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 7.5 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 7.4 | ||||
| LDTP10887 | Synaptic vesicle membrane protein VAT-1 homolog (VAT1) | 7.4 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 7.3 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 7.2 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 55.7 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 53.4 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 35.8 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 29.4 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 27.7 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 26.5 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 24.4 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 24.1 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 23.8 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 22.6 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 22.2 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 21.3 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 19.8 | ||||
| LDTP11855 | Pinin (PNN) | 18.9 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 18.6 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 17.3 | ||||
| LDTP04259 | Signal recognition particle 9 kDa protein (SRP9) | 16.8 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 16.3 | ||||
| LDTP05116 | CMP-sialic acid transporter (SLC35A1) | 16.2 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 15.8 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 15.1 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 14.9 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 14.6 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 14.4 | ||||
| LDTP09261 | Major facilitator superfamily domain-containing protein 8 (MFSD8) | 14.1 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 12.6 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 12.3 | ||||
| LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 11.7 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 11.7 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 11.6 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 11.5 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 11.4 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 10.2 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 9.3 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 9.3 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 8.9 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 8.8 | ||||
| LDTP13320 | Prenylated Rab acceptor protein 1 (RABAC1) | 8.8 | ||||
| LDTP18053 | Probable mitochondrial glutathione transporter SLC25A40 (SLC25A40) | 8.8 | ||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | 8.7 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 8.5 | ||||
| LDTP10621 | Sideroflexin-2 (SFXN2) | 8.2 | ||||
| LDTP02215 | Prosaposin (PSAP) | 8.1 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 8.0 | ||||
| LDTP03380 | Stomatin (STOM) | 7.9 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 7.7 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 7.6 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 7.6 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 7.4 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 7.2 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP14610 | Golgi pH regulator B (GPR89B) | 8.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 31.6 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 29.4 | ||||
| LDTP11533 | Oxysterol-binding protein-related protein 6 (OSBPL6) | 22.2 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 13.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 13.3 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 13.0 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 13.0 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 12.6 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 12.3 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 11.9 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 11.8 | ||||
| LDTP07419 | Centromere protein P (CENPP) | 11.5 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 11.4 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 11.4 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 11.3 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 11.2 | ||||
| LDTP09143 | Divergent protein kinase domain 2A (DIPK2A) | 11.2 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 11.2 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 10.9 | ||||
| LDTP04979 | U6 snRNA-associated Sm-like protein LSm3 (LSM3) | 10.7 | ||||
| LDTP13630 | Neudesin (NENF) | 10.6 | ||||
| LDTP12476 | Translation initiation factor eIF2B subunit gamma (EIF2B3) | 10.6 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 10.4 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 10.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 10.3 | ||||
| LDTP15714 | Mdm2-binding protein (MTBP) | 9.8 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 9.1 | ||||
| LDTP06868 | Angiomotin (AMOT) | 9.1 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 9.1 | ||||
| LDTP18467 | LYR motif-containing protein 2 (LYRM2) | 9.0 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 8.5 | ||||
| LDTP13507 | BAG family molecular chaperone regulator 5 (BAG5) | 8.2 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 8.2 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 8.1 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 7.9 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 7.9 | ||||
| LDTP10357 | RUS family member 1 (RUSF1) | 7.9 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 7.8 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 7.8 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 7.7 | ||||
| LDTP06948 | Protein YIF1B (YIF1B) | 7.7 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 7.5 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 7.5 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 7.4 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 7.4 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 7.4 | ||||
| LDTP17730 | UPF0690 protein C1orf52 (C1orf52) | 7.3 | ||||
