Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C346 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 50.6 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 44.0 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 39.1 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 36.8 | ||||
| LDTP12415 | Adenosine 5'-monophosphoramidase HINT3 (HINT3) | 34.3 | ||||
| LDTP02713 | Macrophage migration inhibitory factor (MIF) | 30.7 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 30.3 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 29.9 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 27.1 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 25.1 | ||||
| LDTP06227 | Prostaglandin reductase 1 (PTGR1) | 24.8 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 24.4 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 23.6 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 21.7 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 21.6 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 21.3 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 21.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 20.5 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 20.3 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 19.7 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 18.9 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 18.6 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 18.4 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 18.3 | ||||
| LDTP01759 | Histone-lysine N-methyltransferase NSD2 (NSD2) | 18.1 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 18.0 | ||||
| LDTP10322 | Abasic site processing protein HMCES (HMCES) | 17.5 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 17.4 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 17.3 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 17.1 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 16.7 | ||||
| LDTP12490 | Sphingosine kinase 2 (SPHK2) | 16.7 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 16.2 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 16.0 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 15.9 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 15.8 | ||||
| LDTP12003 | Ribosomal oxygenase 1 (RIOX1) | 15.8 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 15.7 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 15.5 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 15.3 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 15.0 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 15.0 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 14.9 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 14.9 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 14.8 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 14.7 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 14.7 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 14.4 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 14.1 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 13.8 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 13.7 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 13.6 | ||||
| LDTP08564 | E3 ubiquitin-protein ligase UBR1 (UBR1) | 13.6 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 13.4 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 13.3 | ||||
| LDTP10780 | Trimethylguanosine synthase (TGS1) | 13.3 | ||||
| LDTP09819 | Unconventional myosin-XVIIIa (MYO18A) | 13.2 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 13.1 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 12.9 | ||||
| LDTP10709 | Pseudouridylate synthase 7 homolog (PUS7) | 12.7 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 12.6 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 12.3 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 12.0 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 11.9 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 11.7 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 11.5 | ||||
| LDTP01245 | Enoyl-CoA delta isomerase 2 (ECI2) | 11.5 | ||||
| LDTP10785 | Ubiquitin carboxyl-terminal hydrolase 28 (USP28) | 11.4 | ||||
| LDTP10215 | Carboxymethylenebutenolidase homolog (CMBL) | 11.3 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 11.2 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 11.2 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 11.2 | ||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | 11.2 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 11.1 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 11.0 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 10.9 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 10.9 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 10.9 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 10.8 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 10.7 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 10.7 | ||||
| LDTP08979 | Prostaglandin reductase 2 (PTGR2) | 10.5 | ||||
| LDTP11823 | Peptidyl-prolyl cis-trans isomerase-like 3 (PPIL3) | 10.4 | ||||
| LDTP06069 | DNA polymerase alpha subunit B (POLA2) | 10.3 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 52.7 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 31.1 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 26.2 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 24.6 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 24.4 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 24.1 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 20.0 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 19.7 | ||||
| LDTP02215 | Prosaposin (PSAP) | 19.0 | ||||
| LDTP10885 | Sortilin (SORT1) | 17.6 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 17.5 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 17.0 | ||||
| LDTP03380 | Stomatin (STOM) | 16.6 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 16.2 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 15.7 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 15.2 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 14.7 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 14.6 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 14.1 | ||||
| LDTP03546 | Translocator protein (TSPO) | 14.1 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 13.4 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 13.3 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 13.2 | ||||
| LDTP00857 | Syntaxin-6 (STX6) | 13.1 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 12.9 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 12.8 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 12.8 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 12.6 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 12.3 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 12.2 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 11.4 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 11.3 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 11.2 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 10.9 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 10.6 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 10.5 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 10.2 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 10.2 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02870 | Y-box-binding protein 3 (YBX3) | 11.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 87.4 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 42.2 | ||||
| LDTP16078 | Heme-binding protein 1 (HEBP1) | 34.3 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 31.3 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 30.5 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 26.0 | ||||
| LDTP10299 | Enhancer of mRNA-decapping protein 3 (EDC3) | 24.6 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 21.9 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 21.3 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 18.5 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 18.4 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 16.4 | ||||
| LDTP02297 | Vimentin (VIM) | 16.4 | ||||
| LDTP13630 | Neudesin (NENF) | 16.2 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 16.2 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 15.7 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 15.6 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 14.6 | ||||
| LDTP15283 | Nucleolar protein 9 (NOP9) | 14.4 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 14.0 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 13.6 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 13.6 | ||||
| LDTP06915 | Borealin (CDCA8) | 13.4 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 13.3 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 13.2 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 13.1 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 13.0 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 12.9 | ||||
| LDTP11328 | Splicing factor 3B subunit 5 (SF3B5) | 12.9 | ||||
| LDTP02351 | Tropomyosin alpha-1 chain (TPM1) | 12.4 | ||||
| LDTP09215 | Torsin-1A-interacting protein 2 (TOR1AIP2) | 12.3 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 12.2 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 12.2 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 12.1 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 11.9 | ||||
| LDTP01075 | Protein CutA (CUTA) | 11.9 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 11.8 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 11.8 | ||||
| LDTP12629 | T-complex protein 11-like protein 1 (TCP11L1) | 11.8 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 11.6 | ||||
| LDTP06515 | Coiled-coil domain-containing protein 6 (CCDC6) | 11.6 | ||||
| LDTP10700 | KH domain-containing RNA-binding protein QKI (QKI) | 11.6 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 11.5 | ||||
| LDTP01246 | KH domain-containing, RNA-binding, signal transduction-associated protein 3 (KHDRBS3) | 11.4 | ||||
| LDTP13851 | Exocyst complex component 6B (EXOC6B) | 11.3 | ||||
| LDTP05068 | Tropomyosin alpha-4 chain (TPM4) | 11.3 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 11.2 | ||||
| LDTP00887 | Calumenin (CALU) | 11.2 | ||||
| LDTP05113 | T-complex protein 1 subunit beta (CCT2) | 11.1 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 11.0 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 10.9 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 10.9 | ||||
| LDTP03182 | Heterogeneous nuclear ribonucleoproteins A2/B1 (HNRNPA2B1) | 10.6 | ||||
| LDTP03850 | RNA-binding motif protein, X chromosome (RBMX) | 10.6 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 10.5 | ||||
| LDTP09054 | Golgi membrane protein 1 (GOLM1) | 10.5 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 10.4 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 10.3 | ||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | 10.3 | ||||
| LDTP09410 | Protein bicaudal D homolog 2 (BICD2) | 10.3 | ||||
| LDTP12623 | Zinc finger CCHC domain-containing protein 3 (ZCCHC3) | 10.3 | ||||
| LDTP06952 | DBIRD complex subunit ZNF326 (ZNF326) | 10.3 | ||||
| LDTP01582 | Pre-mRNA-splicing factor SLU7 (SLU7) | 10.3 | ||||
| LDTP06068 | MAGUK p55 subfamily member 2 (MPP2) | 10.2 | ||||
