Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C244 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01561 | NADH dehydrogenase 1 alpha subcomplex subunit 10, mitochondrial (NDUFA10) | 66.3 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 59.7 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 50.6 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 49.2 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 41.6 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 39.7 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 39.7 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 39.1 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 38.3 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 36.3 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 32.2 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 30.7 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 30.3 | ||||
| LDTP03331 | Proteasome subunit alpha type-2 (PSMA2) | 30.1 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 29.2 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 28.4 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 27.7 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 27.1 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 26.5 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 26.2 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 26.0 | ||||
| LDTP10215 | Carboxymethylenebutenolidase homolog (CMBL) | 25.8 | ||||
| LDTP13352 | GTP:AMP phosphotransferase AK3, mitochondrial (AK3) | 25.6 | ||||
| LDTP08598 | NAD-dependent protein deacetylase sirtuin-2 (SIRT2) | 25.5 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 25.3 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 24.9 | ||||
| LDTP02783 | Ubiquitin carboxyl-terminal hydrolase isozyme L3 (UCHL3) | 24.3 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 24.1 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 23.6 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 23.4 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 22.6 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 21.9 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 21.3 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 20.8 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 20.5 | ||||
| LDTP11437 | Peroxisomal trans-2-enoyl-CoA reductase (PECR) | 20.5 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 20.5 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 19.2 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 18.6 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 18.6 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 18.5 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 18.5 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 18.3 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 17.9 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 17.9 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 17.5 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 17.1 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 16.9 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 16.9 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 16.9 | ||||
| LDTP07868 | Protein O-mannosyl-transferase TMTC3 (TMTC3) | 16.9 | ||||
| LDTP05446 | Ubiquitin-protein ligase E3A (UBE3A) | 16.7 | ||||
| LDTP04374 | Dynamin-2 (DNM2) | 16.4 | ||||
| LDTP12610 | Obg-like ATPase 1 (OLA1) | 16.4 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 15.7 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 15.7 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 15.6 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 15.2 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 15.2 | ||||
| LDTP12588 | Isoleucine--tRNA ligase, mitochondrial (IARS2) | 14.9 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 14.7 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 14.6 | ||||
| LDTP03817 | Lon protease homolog, mitochondrial (LONP1) | 13.9 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 13.8 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 58.1 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 57.3 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 45.3 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 42.5 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 39.7 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 38.9 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 37.3 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 36.3 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 36.3 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 33.6 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 32.0 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 31.8 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 31.1 | ||||
| LDTP10663 | Importin-9 (IPO9) | 30.5 | ||||
| LDTP03546 | Translocator protein (TSPO) | 30.5 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 29.7 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 28.8 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 27.9 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 26.7 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 24.6 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 24.6 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 23.6 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 22.5 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 22.2 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 22.2 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 20.5 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 19.6 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 19.3 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 18.6 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 18.4 | ||||
| LDTP03811 | V-type proton ATPase subunit E 1 (ATP6V1E1) | 17.8 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 17.6 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 17.5 | ||||
| LDTP09203 | Nucleoporin Nup37 (NUP37) | 16.3 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 16.2 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 16.1 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 16.0 | ||||
| LDTP00010 | Intraflagellar transport protein 56 (IFT56) | 15.9 | ||||
| LDTP05667 | Syntaxin-4 (STX4) | 15.6 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 15.5 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 15.5 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 15.5 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 14.5 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 14.4 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 14.3 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 14.3 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 14.3 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 14.2 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 14.0 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 13.9 | ||||
| LDTP04237 | Protein ERGIC-53 (LMAN1) | 13.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 99.7 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 45.3 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 43.4 | ||||
| LDTP14939 | Membralin (TMEM259) | 36.8 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 36.8 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 31.6 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 31.3 | ||||
| LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 30.5 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 29.2 | ||||
| LDTP16078 | Heme-binding protein 1 (HEBP1) | 27.5 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 27.3 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 25.1 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 24.8 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 24.8 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 24.4 | ||||
| LDTP19785 | Transmembrane protein 35B (TMEM35B) | 23.9 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 23.8 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 23.4 | ||||
| LDTP12025 | UPF0488 protein C8orf33 (C8orf33) | 23.3 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 22.9 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 22.8 | ||||
| LDTP09870 | Signal transducing adapter molecule 1 (STAM) | 22.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 21.9 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 21.7 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 21.7 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 21.1 | ||||
| LDTP12287 | Ran guanine nucleotide release factor (RANGRF) | 20.5 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 20.4 | ||||
| LDTP02297 | Vimentin (VIM) | 20.1 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 20.0 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 19.3 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 18.9 | ||||
| LDTP06292 | Rab3 GTPase-activating protein catalytic subunit (RAB3GAP1) | 18.3 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 18.1 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 18.0 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 18.0 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 18.0 | ||||
| LDTP14126 | Mitochondrial import inner membrane translocase subunit Tim9 (TIMM9) | 17.8 | ||||
| LDTP05277 | Protein SET (SET) | 17.8 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 17.5 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 17.3 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 17.1 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 17.0 | ||||
| LDTP19912 | Protein NipSnap homolog 1 (NIPSNAP1) | 16.9 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 16.9 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 16.7 | ||||
| LDTP10213 | Anaphase-promoting complex subunit 16 (ANAPC16) | 16.4 | ||||
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 16.4 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 16.4 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 16.1 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 16.1 | ||||
| LDTP01075 | Protein CutA (CUTA) | 16.1 | ||||
| LDTP00887 | Calumenin (CALU) | 16.0 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 15.8 | ||||
| LDTP11113 | Receptor expression-enhancing protein 2 (REEP2) | 15.8 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 15.5 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 15.2 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 15.1 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 15.0 | ||||
| LDTP10927 | COP9 signalosome complex subunit 8 (COPS8) | 14.9 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 14.8 | ||||
| LDTP02535 | Laminin subunit gamma-1 (LAMC1) | 14.8 | ||||
| LDTP09589 | Charged multivesicular body protein 7 (CHMP7) | 14.7 | ||||
| LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 14.7 | ||||
| LDTP06121 | Caprin-1 (CAPRIN1) | 14.6 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 14.6 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 14.6 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 14.3 | ||||
| LDTP04206 | Nestin (NES) | 14.3 | ||||
| LDTP13622 | NFU1 iron-sulfur cluster scaffold homolog, mitochondrial (NFU1) | 14.3 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 14.3 | ||||
| LDTP04111 | Small ribosomal subunit protein eS10 (RPS10) | 14.2 | ||||
| LDTP09671 | U4/U6 small nuclear ribonucleoprotein Prp31 (PRPF31) | 14.2 | ||||
| LDTP09410 | Protein bicaudal D homolog 2 (BICD2) | 13.8 | ||||
| LDTP05418 | UBX domain-containing protein 1 (UBXN1) | 13.8 | ||||
