Details of the Probe-central Interaction Altas
General Information of Experiment
Probe Name | C357 | Probe Info | ||||
---|---|---|---|---|---|---|
Probe concentration | Probe:50uM; negative probe:50uM | |||||
Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
Quantitative Method |
TMT
|
|||||
In Vivo Experiment Model | Model Type |
|
Living cell | |||
Derived Tissue |
|
Peripheral blood | ||||
Disease Model | Normal | |||||
Model Name | Human normal cells (HEK-293T) | |||||
Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 |
Interaction Altas of This Experiment [1]
Enzyme
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP03540 | Heme oxygenase 2 (HMOX2) | 28.1 | ||||
LDTP00697 | Cytochrome b5 type B (CYB5B) | 27.9 | ||||
LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 20.0 | ||||
LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 18.8 | ||||
LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 15.6 | ||||
LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 15.0 | ||||
LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 14.8 | ||||
LDTP02359 | Heme oxygenase 1 (HMOX1) | 14.1 | ||||
LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 14.1 | ||||
LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 13.9 | ||||
LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 12.7 | ||||
LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 12.4 | ||||
LDTP03842 | Squalene synthase (FDFT1) | 11.9 | ||||
LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 11.1 | ||||
LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 11.0 | ||||
LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 10.3 | ||||
LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 10.0 | ||||
LDTP02837 | Beta-galactosidase (GLB1) | 9.8 | ||||
LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 9.6 | ||||
LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 9.5 | ||||
LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 9.2 | ||||
LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 9.2 | ||||
LDTP14189 | UbiA prenyltransferase domain-containing protein 1 (UBIAD1) | 9.2 | ||||
LDTP03394 | Ceramide synthase 1 (CERS1) | 8.9 | ||||
LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 8.8 | ||||
LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 8.8 | ||||
LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 8.8 | ||||
LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 8.7 | ||||
LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 8.4 | ||||
LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 8.3 | ||||
LDTP06617 | Ceramide glucosyltransferase (UGCG) | 8.3 | ||||
LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 8.2 | ||||
LDTP05905 | Acid ceramidase (ASAH1) | 8.1 | ||||
LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 8.1 | ||||
LDTP01389 | Delta(14)-sterol reductase TM7SF2 (TM7SF2) | 8.1 | ||||
LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 8.1 | ||||
LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 8.0 | ||||
LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 7.8 | ||||
LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 7.8 | ||||
LDTP01515 | NADH dehydrogenase 1 beta subcomplex subunit 8, mitochondrial (NDUFB8) | 7.6 | ||||
LDTP13409 | Anaphase-promoting complex subunit 7 (ANAPC7) | 7.5 | ||||
LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 7.4 | ||||
LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 7.1 | ||||
LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 7.0 | ||||
LDTP03145 | Catechol O-methyltransferase (COMT) | 7.0 | ||||
LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 7.0 | ||||
LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 6.9 | ||||
LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 6.8 | ||||
LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 6.7 | ||||
LDTP00988 | Protein O-GlcNAcase (OGA) | 6.5 | ||||
LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 6.5 | ||||
LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 6.5 | ||||
LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 6.5 | ||||
LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 6.4 | ||||
LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 6.4 | ||||
LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 6.4 | ||||
LDTP07109 | ATP-binding cassette sub-family C member 10 (ABCC10) | 6.2 | ||||
LDTP08933 | Chondroitin sulfate N-acetylgalactosaminyltransferase 2 (CSGALNACT2) | 6.2 | ||||
LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 6.2 | ||||
LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 6.2 | ||||
LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 6.1 | ||||
LDTP02539 | Lysosomal acid phosphatase (ACP2) | 6.1 | ||||
LDTP11318 | ADP-ribose pyrophosphatase, mitochondrial (NUDT9) | 5.9 | ||||
LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 5.9 | ||||
LDTP11127 | ADP-dependent glucokinase (ADPGK) | 5.8 | ||||
LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 5.8 | ||||
LDTP10530 | Beta-1,3-galactosyltransferase 6 (B3GALT6) | 5.7 | ||||
LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 5.7 | ||||
LDTP06142 | Squalene monooxygenase (SQLE) | 5.6 | ||||
LDTP12886 | Glycerophosphodiester phosphodiesterase 1 (GDE1) | 5.5 | ||||
LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 5.5 | ||||
LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 5.3 | ||||
LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 5.3 | ||||
LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 5.3 | ||||
LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 5.2 | ||||
LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 5.2 | ||||
LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 5.2 | ||||
LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 5.2 | ||||
LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 5.1 | ||||
LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 5.1 | ||||
LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 5.1 |
Transporter and channel
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 66.7 | ||||
LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 54.9 | ||||
LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 28.2 | ||||
LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 28.1 | ||||
LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 24.8 | ||||
LDTP01804 | ATP synthase subunit a (MT-ATP6) | 23.4 | ||||
LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 20.4 | ||||
LDTP11615 | Protein tweety homolog 3 (TTYH3) | 18.6 | ||||
LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 18.5 | ||||
LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 16.8 | ||||
LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 15.9 | ||||
LDTP02215 | Prosaposin (PSAP) | 14.5 | ||||
LDTP05662 | Cell division cycle protein 20 homolog (CDC20) | 14.1 | ||||
LDTP15967 | Tetraspanin-10 (TSPAN10) | 13.6 | ||||
LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 13.0 | ||||
LDTP16813 | Tetraspanin-3 (TSPAN3) | 12.6 | ||||
LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 12.3 | ||||
LDTP20002 | Transmembrane protein 160 (TMEM160) | 11.2 | ||||
LDTP06633 | Reticulon-1 (RTN1) | 11.1 | ||||
LDTP08881 | Transmembrane protein 199 (TMEM199) | 9.8 | ||||
LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 9.4 | ||||
LDTP15948 | Transmembrane protein 126A (TMEM126A) | 9.3 | ||||
LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 8.3 | ||||
LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 8.2 | ||||
LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 7.9 | ||||
LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 7.8 | ||||
LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 7.8 | ||||
LDTP15648 | BRI3-binding protein (BRI3BP) | 7.7 | ||||
LDTP10036 | BOS complex subunit NCLN (NCLN) | 7.6 | ||||
LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 7.3 | ||||
LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 7.0 | ||||
LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 6.5 | ||||
LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 6.5 | ||||
LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 6.5 | ||||
LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 6.5 | ||||
LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 6.4 | ||||
LDTP11213 | Nucleoporin NDC1 (NDC1) | 6.4 | ||||
LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 6.2 | ||||
LDTP02071 | Amyloid-beta precursor protein (APP) | 6.0 | ||||
LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | 5.9 | ||||
LDTP11844 | Protein spinster homolog 1 (SPNS1) | 5.8 | ||||
LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 5.7 | ||||
LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.7 | ||||
LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 5.7 | ||||
LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 5.5 | ||||
LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 5.5 | ||||
LDTP15064 | G-protein coupled receptor-associated protein LMBRD2 (LMBRD2) | 5.5 | ||||
LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 5.4 | ||||
LDTP16190 | Protein FAM8A1 (FAM8A1) | 5.4 | ||||
LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 5.2 | ||||
LDTP01574 | Importin-7 (IPO7) | 5.1 | ||||
LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 5.1 | ||||
LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 5.1 |
GPCR
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 10.6 |
Other
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 27.1 | ||||
LDTP05160 | Nucleobindin-2 (NUCB2) | 23.1 | ||||
LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 19.7 | ||||
LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 18.6 | ||||
LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 18.1 | ||||
LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 14.9 | ||||
LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 14.7 | ||||
LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 14.4 | ||||
LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 12.4 | ||||
LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 12.3 | ||||
LDTP05375 | Nucleobindin-1 (NUCB1) | 10.9 | ||||
LDTP13802 | DNA replication complex GINS protein PSF2 (GINS2) | 10.8 | ||||
LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 9.7 | ||||
LDTP14458 | Tetraspanin-6 (TSPAN6) | 8.9 | ||||
LDTP01522 | Reticulon-3 (RTN3) | 8.8 | ||||
LDTP16080 | Protein FAM114A2 (FAM114A2) | 8.5 | ||||
LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 8.5 | ||||
LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 7.9 | ||||
LDTP08224 | Protein LYRIC (MTDH) | 7.7 | ||||
LDTP01652 | Centrosomal protein 43 (CEP43) | 7.5 | ||||
LDTP10056 | Protein FAM162A (FAM162A) | 7.4 | ||||
LDTP00105 | Protein unc-119 homolog B (UNC119B) | 7.2 | ||||
LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 7.1 | ||||
LDTP19963 | TraB domain-containing protein (TRABD) | 6.9 | ||||
LDTP00859 | Synaptogyrin-2 (SYNGR2) | 6.9 | ||||
LDTP02443 | Calmodulin-3 (CALM3) | 6.8 | ||||
LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 6.5 | ||||
LDTP12412 | Reticulon-4 (RTN4) | 6.1 | ||||
LDTP11533 | Oxysterol-binding protein-related protein 6 (OSBPL6) | 6.0 | ||||
LDTP11143 | Centromere protein K (CENPK) | 5.9 | ||||
LDTP13086 | Syntaxin-18 (STX18) | 5.9 | ||||
LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 5.8 | ||||
LDTP16006 | Optic atrophy 3 protein (OPA3) | 5.6 | ||||
LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 5.5 | ||||
LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 5.5 | ||||
LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 5.4 | ||||
LDTP08594 | Negative elongation factor C/D (NELFCD) | 5.4 | ||||
LDTP09080 | Reticulophagy regulator 2 (RETREG2) | 5.2 | ||||
LDTP00986 | Syntaxin-10 (STX10) | 5.2 | ||||
LDTP01494 | Protein YIF1A (YIF1A) | 5.2 |