Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C426 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 99.7 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 98.4 | ||||
| LDTP08017 | Endoplasmic reticulum metallopeptidase 1 (ERMP1) | 86.8 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 85.6 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 74.5 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 74.0 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 60.1 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 56.9 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 55.7 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 54.9 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 52.3 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 49.9 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 41.1 | ||||
| LDTP01273 | Acyl-protein thioesterase 1 (LYPLA1) | 39.9 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 34.1 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 34.1 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 30.1 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 29.0 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 28.6 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 28.1 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 27.7 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 26.4 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 25.8 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 24.6 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 24.6 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 24.1 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 22.8 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 22.0 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 22.0 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 21.6 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 20.8 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 20.8 | ||||
| LDTP04618 | Ubiquitin carboxyl-terminal hydrolase 14 (USP14) | 19.8 | ||||
| LDTP06322 | [Pyruvate dehydrogenase (acetyl-transferring)] kinase isozyme 3, mitochondrial (PDK3) | 19.7 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 19.2 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 18.0 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 17.9 | ||||
| LDTP04247 | Protein farnesyltransferase subunit beta (FNTB) | 17.9 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 17.6 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 17.6 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 17.4 | ||||
| LDTP11012 | 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha (AGPAT1) | 17.0 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 17.0 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 16.7 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 16.6 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 16.4 | ||||
| LDTP09845 | Geranylgeranyl transferase type-2 subunit alpha (RABGGTA) | 15.6 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 15.6 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 15.6 | ||||
| LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 14.8 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 14.5 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 14.2 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 14.2 | ||||
| LDTP08598 | NAD-dependent protein deacetylase sirtuin-2 (SIRT2) | 14.1 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 14.0 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 14.0 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 13.9 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 13.9 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 13.8 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 13.8 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 13.5 | ||||
| LDTP04144 | Cytochrome b-c1 complex subunit Rieske, mitochondrial (UQCRFS1) | 13.5 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 13.4 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 13.4 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 13.4 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 13.2 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 13.2 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 13.1 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 12.8 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 12.8 | ||||
| LDTP04289 | Very long-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADVL) | 12.7 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 12.6 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 87.4 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 81.0 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 71.5 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 61.4 | ||||
| LDTP03546 | Translocator protein (TSPO) | 60.1 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 54.9 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 49.9 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 46.5 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 44.6 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 41.9 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 35.8 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 35.3 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 34.5 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 32.0 | ||||
| LDTP09261 | Major facilitator superfamily domain-containing protein 8 (MFSD8) | 31.8 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 28.4 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 27.9 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 27.5 | ||||
| LDTP07063 | Hippocampus abundant transcript-like protein 1 (MFSD14B) | 26.9 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 26.9 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 25.1 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 24.4 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 22.9 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 22.3 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 22.2 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 22.2 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 20.7 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 20.1 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 18.6 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 18.3 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 18.3 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 17.9 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 17.6 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 17.5 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 17.1 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 16.9 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 15.7 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 15.3 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 14.9 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 14.9 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 14.8 | ||||
| LDTP10343 | Vacuole membrane protein 1 (VMP1) | 14.8 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 14.7 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 14.7 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 14.2 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 14.1 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 14.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 14.0 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 14.0 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 13.8 | ||||
| LDTP00970 | Gasdermin-E (GSDME) | 13.5 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 13.5 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 13.5 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 13.2 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 12.9 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 12.7 | ||||
| LDTP06198 | Major facilitator superfamily domain-containing protein 10 (MFSD10) | 12.6 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 12.6 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 14.8 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 50.6 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 50.2 | ||||
| LDTP02736 | Myosin light chain 6B (MYL6B) | 49.2 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 48.8 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 48.2 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 43.1 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 41.4 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 40.8 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 33.6 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 29.0 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 27.3 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 23.3 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 22.9 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 22.3 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 22.0 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 21.7 | ||||
| LDTP14939 | Membralin (TMEM259) | 21.4 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 20.5 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 20.1 | ||||
| LDTP01155 | Ankyrin repeat domain-containing protein 17 (ANKRD17) | 19.7 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 19.6 | ||||
| LDTP05277 | Protein SET (SET) | 19.0 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 18.8 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 17.6 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 17.0 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 16.8 | ||||
| LDTP01075 | Protein CutA (CUTA) | 16.1 | ||||
| LDTP15345 | Zinc finger CCCH domain-containing protein 7A (ZC3H7A) | 16.1 | ||||
| LDTP04703 | Tumor protein D52 (TPD52) | 15.7 | ||||
| LDTP11533 | Oxysterol-binding protein-related protein 6 (OSBPL6) | 15.0 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 15.0 | ||||
| LDTP13630 | Neudesin (NENF) | 13.8 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 13.0 | ||||
| LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 12.9 | ||||
