Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C419 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 65.8 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 63.1 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 54.6 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 46.9 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 43.7 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 37.3 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 37.0 | ||||
| LDTP01983 | NADH-ubiquinone oxidoreductase chain 2 (MT-ND2) | 35.5 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 32.4 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 32.2 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 32.0 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 31.1 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 30.9 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 30.3 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 27.7 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 27.5 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 26.7 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 26.0 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 25.6 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 25.1 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 23.4 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 22.5 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 22.3 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 21.1 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 20.1 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 20.0 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 19.3 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 18.9 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 18.9 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 18.3 | ||||
| LDTP08390 | Kinesin-like protein KIF18B (KIF18B) | 17.8 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 17.8 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 17.6 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 16.9 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 16.4 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 16.4 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 16.2 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 16.1 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 15.6 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 14.7 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 14.5 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 14.4 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 14.3 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 13.8 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 13.8 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 13.6 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 13.5 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 13.4 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 13.0 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 13.0 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 12.3 | ||||
| LDTP16040 | Glyoxalase domain-containing protein 4 (GLOD4) | 12.0 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 12.0 | ||||
| LDTP01759 | Histone-lysine N-methyltransferase NSD2 (NSD2) | 12.0 | ||||
| LDTP04203 | Phosphatidylserine synthase 1 (PTDSS1) | 12.0 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 11.6 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 11.6 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 11.6 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 11.6 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 11.2 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 11.1 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 11.0 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 11.0 | ||||
| LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 10.9 | ||||
| LDTP08564 | E3 ubiquitin-protein ligase UBR1 (UBR1) | 10.9 | ||||
| LDTP12610 | Obg-like ATPase 1 (OLA1) | 10.9 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 10.8 | ||||
| LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | 10.5 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 10.3 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 9.8 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 9.4 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 9.3 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 9.2 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 9.2 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 9.0 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 8.9 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 8.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 69.1 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 65.8 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 57.7 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 53.8 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 50.2 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 50.2 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 47.5 | ||||
| LDTP02215 | Prosaposin (PSAP) | 45.9 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 42.5 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 40.8 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 37.8 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 35.3 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 26.4 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 24.4 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 24.3 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 23.8 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 23.3 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 22.8 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 22.2 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 18.1 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 17.3 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 16.8 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 15.9 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 14.7 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 14.2 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 13.0 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 12.9 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 12.9 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 12.4 | ||||
| LDTP00010 | Intraflagellar transport protein 56 (IFT56) | 12.0 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 12.0 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 10.7 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 10.6 | ||||
| LDTP03546 | Translocator protein (TSPO) | 10.6 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 10.3 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 10.3 | ||||
| LDTP11291 | Transmembrane emp24 domain-containing protein 9 (TMED9) | 9.6 | ||||
| LDTP01455 | Erlin-2 (ERLIN2) | 9.4 | ||||
| LDTP01234 | Erlin-1 (ERLIN1) | 9.0 | ||||
| LDTP11824 | Sodium-coupled neutral amino acid symporter 1 (SLC38A1) | 8.9 | ||||
| LDTP07583 | Transmembrane protein 65 (TMEM65) | 8.9 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP09694 | Paraspeckle component 1 (PSPC1) | 10.0 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 8.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 59.3 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 46.2 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 33.1 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 31.6 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 30.3 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 26.5 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 24.8 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 24.6 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 23.1 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 22.9 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 20.8 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 20.1 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 19.0 | ||||
| LDTP18132 | Protein FAM136A (FAM136A) | 18.8 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 18.4 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 17.6 | ||||
| LDTP05089 | Immunoglobulin-binding protein 1 (IGBP1) | 17.1 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 16.4 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 15.7 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 15.3 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 14.6 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 14.4 | ||||
| LDTP08094 | Wings apart-like protein homolog (WAPL) | 14.3 | ||||
| LDTP15714 | Mdm2-binding protein (MTBP) | 13.9 | ||||
| LDTP06543 | DNA damage-binding protein 1 (DDB1) | 13.6 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 13.5 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 13.4 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 13.1 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 12.5 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 12.0 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 11.8 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 11.6 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 11.2 | ||||
| LDTP07400 | Elongator complex protein 2 (ELP2) | 11.2 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 10.1 | ||||
| LDTP14058 | Rap guanine nucleotide exchange factor 2 (RAPGEF2) | 10.0 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 9.9 | ||||
| LDTP10289 | Cytoplasmic FMR1-interacting protein 2 (CYFIP2) | 9.4 | ||||
| LDTP12476 | Translation initiation factor eIF2B subunit gamma (EIF2B3) | 9.4 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 9.0 | ||||
| LDTP08153 | Transmembrane emp24 domain-containing protein 4 (TMED4) | 9.0 | ||||
| LDTP11044 | Polyadenylate-binding protein-interacting protein 2 (PAIP2) | 8.8 | ||||
| LDTP02297 | Vimentin (VIM) | 8.7 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 8.6 | ||||
| LDTP13813 | Eukaryotic translation initiation factor 3 subunit L (EIF3L) | 8.6 | ||||
| LDTP08606 | Nurim (NRM) | 8.5 | ||||
| LDTP14263 | TAF6-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 6L (TAF6L) | 8.5 | ||||
