Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C197 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 26.9 | ||||
| LDTP12732 | Hypoxia-inducible factor 1-alpha inhibitor (HIF1AN) | 22.2 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 21.9 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 20.7 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 19.8 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 18.9 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 18.3 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 17.6 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 17.5 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 15.9 | ||||
| LDTP10888 | Legumain (LGMN) | 15.8 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 15.7 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 14.3 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 13.9 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 13.5 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 12.9 | ||||
| LDTP00185 | Deoxyribonuclease-2-alpha (DNASE2) | 12.7 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 12.5 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 12.3 | ||||
| LDTP01372 | Carboxypeptidase D (CPD) | 12.2 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 11.7 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 11.6 | ||||
| LDTP00282 | Beta-mannosidase (MANBA) | 11.0 | ||||
| LDTP10318 | Ubiquitin thioesterase OTUB1 (OTUB1) | 10.7 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 10.5 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 10.3 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 9.9 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 9.8 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 9.8 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 9.6 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 9.5 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 9.4 | ||||
| LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | 9.3 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 9.3 | ||||
| LDTP03541 | Adenylosuccinate synthetase isozyme 2 (ADSS2) | 9.1 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 8.8 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 8.5 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 8.5 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 8.5 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 8.3 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 8.2 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 8.2 | ||||
| LDTP09886 | Gamma-glutamyl hydrolase (GGH) | 8.0 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 7.9 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 7.8 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 7.8 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 7.8 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 7.7 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 7.4 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 7.3 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 7.2 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 7.2 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 7.1 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 6.9 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 6.8 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 6.8 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 6.7 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 6.3 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 6.2 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 6.2 | ||||
| LDTP12610 | Obg-like ATPase 1 (OLA1) | 6.2 | ||||
| LDTP06370 | Ephrin type-A receptor 7 (EPHA7) | 6.1 | ||||
| LDTP07813 | Sulfhydryl oxidase 2 (QSOX2) | 6.1 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 5.8 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 5.8 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 5.7 | ||||
| LDTP09063 | Estradiol 17-beta-dehydrogenase 11 (HSD17B11) | 5.6 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 5.6 | ||||
| LDTP01333 | Isocitrate dehydrogenase [NADP] cytoplasmic (IDH1) | 5.5 | ||||
| LDTP14801 | Di-N-acetylchitobiase (CTBS) | 5.4 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 5.3 | ||||
| LDTP01640 | CCR4-NOT transcription complex subunit 4 (CNOT4) | 5.1 | ||||
| LDTP03060 | Proteasome subunit beta type-1 (PSMB1) | 5.1 | ||||
| LDTP00496 | Long-chain fatty acid transport protein 2 (SLC27A2) | 5.0 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 5.0 | ||||
| LDTP01329 | Lathosterol oxidase (SC5D) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 26.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 16.7 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 16.2 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 15.6 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 15.1 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 15.0 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 13.5 | ||||
| LDTP02586 | Cation-independent mannose-6-phosphate receptor (IGF2R) | 12.1 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 12.0 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 11.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 11.5 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 11.1 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 11.0 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 10.9 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 10.7 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 10.6 | ||||
| LDTP03380 | Stomatin (STOM) | 10.6 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 9.8 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 9.6 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 9.1 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 9.1 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 9.0 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 8.9 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 8.9 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 8.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 8.5 | ||||
| LDTP05116 | CMP-sialic acid transporter (SLC35A1) | 8.2 | ||||
| LDTP06581 | Occludin (OCLN) | 7.9 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 7.8 | ||||
| LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 7.7 | ||||
| LDTP10885 | Sortilin (SORT1) | 7.4 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 7.2 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 7.2 | ||||
| LDTP01969 | Transferrin receptor protein 1 (TFRC) | 7.1 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 7.1 | ||||
| LDTP15000 | Solute carrier family 35 member F1 (SLC35F1) | 7.1 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 6.9 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 6.7 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 6.6 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 6.6 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 6.4 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 6.3 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 6.2 | ||||
| LDTP01427 | Slit homolog 2 protein (SLIT2) | 6.1 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 6.0 | ||||
| LDTP03546 | Translocator protein (TSPO) | 5.8 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 5.5 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 5.4 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 5.4 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 5.3 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 5.3 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02491 | HLA class I histocompatibility antigen, C alpha chain (HLA-C) | 7.8 | ||||
| LDTP04720 | IgG receptor FcRn large subunit p51 (FCGRT) | 7.6 | ||||
| LDTP01913 | HLA class I histocompatibility antigen, B alpha chain (HLA-B) | 5.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 23.1 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 17.9 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 17.5 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 17.4 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 15.1 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 12.3 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 11.6 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 10.3 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 10.0 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 9.1 | ||||
| LDTP05491 | Amyloid beta precursor like protein 2 (APLP2) | 8.8 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 8.6 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 8.5 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 7.7 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 7.6 | ||||
| LDTP06154 | Desmocollin-3 (DSC3) | 7.5 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 7.4 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 7.2 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 6.8 | ||||
| LDTP18561 | Small ribosomal subunit protein mS33 (MRPS33) | 6.6 | ||||
| LDTP12623 | Zinc finger CCHC domain-containing protein 3 (ZCCHC3) | 6.6 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 6.5 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 6.5 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 6.5 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 6.0 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 5.5 | ||||
| LDTP05898 | Sequestosome-1 (SQSTM1) | 5.5 | ||||
| LDTP00887 | Calumenin (CALU) | 5.5 | ||||
| LDTP05318 | RNA-binding protein EWS (EWSR1) | 5.4 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 5.3 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 5.2 | ||||
| LDTP05501 | Fragile X messenger ribonucleoprotein 1 (FMR1) | 5.2 | ||||
| LDTP06735 | Cytoplasmic tRNA 2-thiolation protein 2 (CTU2) | 5.1 | ||||
| LDTP06042 | Desmoglein-2 (DSG2) | 5.1 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 5.0 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 5.0 | ||||
| LDTP17266 | Pre-mRNA-splicing factor 38B (PRPF38B) | 5.0 | ||||
