Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C317 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 29.9 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 18.3 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 14.4 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 14.4 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 13.9 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 13.5 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 13.3 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 13.1 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 12.8 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 11.5 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 10.9 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 10.9 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 10.8 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 10.5 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 10.2 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 10.2 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 9.8 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 9.7 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 9.6 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 9.6 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 9.4 | ||||
| LDTP03677 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA (MAN1A1) | 9.1 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 8.8 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 8.6 | ||||
| LDTP09074 | UDP-glucuronic acid decarboxylase 1 (UXS1) | 8.2 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 8.2 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 8.2 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 8.1 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 7.6 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 7.6 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 7.5 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 7.4 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 7.3 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 7.3 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 7.2 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 7.1 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 7.0 | ||||
| LDTP04542 | Thimet oligopeptidase (THOP1) | 6.8 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 6.8 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 6.7 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 6.3 | ||||
| LDTP07503 | Endoplasmic reticulum aminopeptidase 2 (ERAP2) | 6.3 | ||||
| LDTP08598 | NAD-dependent protein deacetylase sirtuin-2 (SIRT2) | 6.3 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 6.2 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 6.2 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 6.2 | ||||
| LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 6.1 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 6.1 | ||||
| LDTP12109 | Ribitol 5-phosphate transferase FKRP (FKRP) | 6.1 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 6.0 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 5.9 | ||||
| LDTP10495 | Ubiquitin carboxyl-terminal hydrolase 47 (USP47) | 5.8 | ||||
| LDTP09285 | Atypical kinase COQ8A, mitochondrial (COQ8A) | 5.7 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 5.7 | ||||
| LDTP07525 | Protein arginine N-methyltransferase 9 (PRMT9) | 5.7 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 28.6 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 20.3 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 14.0 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 12.2 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 10.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 10.4 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 10.3 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 10.3 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 9.9 | ||||
| LDTP03546 | Translocator protein (TSPO) | 9.9 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 9.7 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 9.6 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 9.2 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 8.9 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 8.2 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 8.1 | ||||
| LDTP14970 | Metaxin-3 (MTX3) | 7.1 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 6.9 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 6.8 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 6.6 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 6.5 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 6.4 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 6.1 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 5.9 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 5.8 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 5.7 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 39.4 | ||||
| LDTP08000 | Dymeclin (DYM) | 29.4 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 19.7 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 15.8 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 13.8 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 13.2 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 13.1 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 11.4 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 11.4 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 11.2 | ||||
| LDTP01711 | Protein ecdysoneless homolog (ECD) | 10.6 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 10.5 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 10.2 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 10.2 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 10.1 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 10.1 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 9.6 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 9.6 | ||||
| LDTP09994 | BLOC-2 complex member HPS3 (HPS3) | 9.5 | ||||
| LDTP05277 | Protein SET (SET) | 9.3 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 8.9 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 8.6 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 8.2 | ||||
| LDTP01075 | Protein CutA (CUTA) | 8.1 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 8.0 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 7.7 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 7.6 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 7.2 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 7.1 | ||||
| LDTP02297 | Vimentin (VIM) | 7.1 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 6.9 | ||||
| LDTP05993 | Exosome complex component RRP4 (EXOSC2) | 6.9 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 6.9 | ||||
| LDTP02351 | Tropomyosin alpha-1 chain (TPM1) | 6.8 | ||||
| LDTP08707 | Proline-, glutamic acid- and leucine-rich protein 1 (PELP1) | 6.7 | ||||
| LDTP11044 | Polyadenylate-binding protein-interacting protein 2 (PAIP2) | 6.6 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 6.6 | ||||
| LDTP06515 | Coiled-coil domain-containing protein 6 (CCDC6) | 6.6 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 6.5 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 6.5 | ||||
| LDTP08073 | Tetratricopeptide repeat protein 21B (TTC21B) | 6.5 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 6.4 | ||||
| LDTP13338 | Vacuolar protein sorting-associated protein 51 homolog (VPS51) | 6.3 | ||||
| LDTP06255 | GTPase-activating protein and VPS9 domain-containing protein 1 (GAPVD1) | 6.1 | ||||
| LDTP05089 | Immunoglobulin-binding protein 1 (IGBP1) | 6.1 | ||||
| LDTP04111 | Small ribosomal subunit protein eS10 (RPS10) | 6.1 | ||||
| LDTP00887 | Calumenin (CALU) | 6.0 | ||||
| LDTP04483 | Hepatoma-derived growth factor (HDGF) | 5.9 | ||||
| LDTP04249 | T-complex protein 1 subunit gamma (CCT3) | 5.9 | ||||
| LDTP09183 | Periphilin-1 (PPHLN1) | 5.8 | ||||
