Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C173 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 29.2 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 19.4 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 17.8 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 17.5 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 17.4 | ||||
| LDTP13240 | Poly [ADP-ribose] polymerase 2 (PARP2) | 15.2 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 14.9 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 13.7 | ||||
| LDTP04375 | Methionine aminopeptidase 2 (METAP2) | 12.7 | ||||
| LDTP04289 | Very long-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADVL) | 12.5 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 12.0 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 11.2 | ||||
| LDTP08322 | Valacyclovir hydrolase (BPHL) | 10.4 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 10.3 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 10.2 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 10.1 | ||||
| LDTP08933 | Chondroitin sulfate N-acetylgalactosaminyltransferase 2 (CSGALNACT2) | 9.8 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 9.6 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 8.9 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 8.6 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 8.5 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 7.9 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 7.9 | ||||
| LDTP07688 | Spliceosome-associated protein CWC27 homolog (CWC27) | 7.8 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 7.6 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 7.1 | ||||
| LDTP12490 | Sphingosine kinase 2 (SPHK2) | 7.0 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 6.9 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 6.7 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 6.7 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 6.5 | ||||
| LDTP07762 | Hydroxysteroid dehydrogenase-like protein 2 (HSDL2) | 6.4 | ||||
| LDTP08455 | Palmitoyltransferase ZDHHC13 (ZDHHC13) | 6.4 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 6.3 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 6.3 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 6.2 | ||||
| LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 6.2 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 6.2 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 6.1 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 5.9 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 5.9 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 5.9 | ||||
| LDTP12679 | Trimethyllysine dioxygenase, mitochondrial (TMLHE) | 5.9 | ||||
| LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | 5.7 | ||||
| LDTP00994 | Beta-1,4-galactosyltransferase 3 (B4GALT3) | 5.7 | ||||
| LDTP06253 | E3 ubiquitin-protein ligase SHPRH (SHPRH) | 5.7 | ||||
| LDTP09074 | UDP-glucuronic acid decarboxylase 1 (UXS1) | 5.7 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 5.6 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 5.6 | ||||
| LDTP08084 | BRCA1-associated protein (BRAP) | 5.5 | ||||
| LDTP02643 | Uracil-DNA glycosylase (UNG) | 5.5 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 5.5 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 5.4 | ||||
| LDTP04519 | Kinesin-like protein KIF11 (KIF11) | 5.4 | ||||
| LDTP06720 | Peroxisomal leader peptide-processing protease (TYSND1) | 5.4 | ||||
| LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 5.3 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 5.2 | ||||
| LDTP08947 | eEF1A lysine and N-terminal methyltransferase (METTL13) | 5.2 | ||||
| LDTP13720 | Ubiquitin carboxyl-terminal hydrolase 24 (USP24) | 5.2 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01100 | Iron-sulfur clusters transporter ABCB7, mitochondrial (ABCB7) | 16.0 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 13.6 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 12.0 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 10.6 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 10.5 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 9.6 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 9.4 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 9.2 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 8.6 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 8.5 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 7.7 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 7.7 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 7.4 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 7.0 | ||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | 6.9 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 6.3 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 6.1 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 6.0 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 6.0 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 5.9 | ||||
| LDTP00857 | Syntaxin-6 (STX6) | 5.8 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 5.5 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 5.5 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 5.5 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 5.4 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 5.3 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 5.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 37.3 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 18.4 | ||||
| LDTP08000 | Dymeclin (DYM) | 14.7 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 14.2 | ||||
| LDTP01075 | Protein CutA (CUTA) | 13.6 | ||||
| LDTP03520 | Phosphatidylethanolamine-binding protein 1 (PEBP1) | 12.9 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 12.0 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 10.1 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 10.0 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 9.8 | ||||
| LDTP14058 | Rap guanine nucleotide exchange factor 2 (RAPGEF2) | 9.6 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 9.1 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 8.8 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 8.8 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 8.6 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 8.1 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 7.7 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 7.5 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 7.4 | ||||
| LDTP13630 | Neudesin (NENF) | 7.2 | ||||
| LDTP02728 | Nidogen-1 (NID1) | 7.1 | ||||
| LDTP11533 | Oxysterol-binding protein-related protein 6 (OSBPL6) | 7.0 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 6.9 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 6.9 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 6.1 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 6.1 | ||||
| LDTP06487 | Syntaxin-binding protein 2 (STXBP2) | 6.0 | ||||
| LDTP19860 | Coiled-coil domain-containing protein 97 (CCDC97) | 6.0 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 5.9 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 5.9 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 5.6 | ||||
| LDTP07037 | WD repeat domain phosphoinositide-interacting protein 3 (WDR45B) | 5.6 | ||||
| LDTP04979 | U6 snRNA-associated Sm-like protein LSm3 (LSM3) | 5.6 | ||||
| LDTP10255 | Protein Hook homolog 2 (HOOK2) | 5.5 | ||||
| LDTP05864 | Beta-2-syntrophin (SNTB2) | 5.2 | ||||
| LDTP18134 | Protein CUSTOS (CUSTOS) | 5.2 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 5.2 | ||||
