Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C409 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 20.5 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 14.4 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 12.8 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 11.5 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 9.7 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 8.8 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 8.6 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 8.2 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 8.2 | ||||
| LDTP14092 | Protein phosphatase methylesterase 1 (PPME1) | 7.7 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 7.6 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 7.5 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 7.4 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 7.3 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 7.3 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 7.2 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 7.1 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 7.0 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 6.6 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 6.3 | ||||
| LDTP04456 | Ubiquitin carboxyl-terminal hydrolase 11 (USP11) | 6.3 | ||||
| LDTP13058 | Thioredoxin domain-containing protein 16 (TXNDC16) | 6.2 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 6.1 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 5.9 | ||||
| LDTP12599 | Ubiquitin-like-conjugating enzyme ATG3 (ATG3) | 5.8 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 5.6 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 5.5 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 5.5 | ||||
| LDTP05560 | Peroxisomal bifunctional enzyme (EHHADH) | 5.4 | ||||
| LDTP03769 | Sterol O-acyltransferase 1 (SOAT1) | 5.4 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 5.2 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 5.2 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 5.1 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 5.0 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 5.0 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 5.0 | ||||
| LDTP04565 | Methionine aminopeptidase 1 (METAP1) | 5.0 | ||||
| LDTP06227 | Prostaglandin reductase 1 (PTGR1) | 5.0 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 5.0 | ||||
| LDTP09228 | N-acylneuraminate cytidylyltransferase (CMAS) | 4.9 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 49.2 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 25.3 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 22.2 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 19.8 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 11.6 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 11.0 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 10.8 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 9.8 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 8.9 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 8.7 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 8.6 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 7.8 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 6.6 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 6.4 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 6.3 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 6.1 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 6.1 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 6.0 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 6.0 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 6.0 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 6.0 | ||||
| LDTP05978 | THO complex subunit 5 homolog (THOC5) | 5.7 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 5.7 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 5.7 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 5.5 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 5.3 | ||||
| LDTP03546 | Translocator protein (TSPO) | 5.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 22.9 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 19.7 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 14.1 | ||||
| LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 13.5 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 13.2 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 12.6 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 12.2 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 11.4 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 10.6 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 9.1 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 7.6 | ||||
| LDTP04914 | Large ribosomal subunit protein uL24 (RPL26) | 7.3 | ||||
| LDTP07574 | Superkiller complex protein 3 (SKIC3) | 7.3 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 7.0 | ||||
| LDTP09626 | Heterogeneous nuclear ribonucleoprotein L-like (HNRNPLL) | 6.4 | ||||
| LDTP03321 | Small ribosomal subunit protein eS12 (RPS12) | 6.4 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 6.0 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 5.7 | ||||
| LDTP12925 | CCR4-NOT transcription complex subunit 2 (CNOT2) | 5.7 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 5.7 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 5.7 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 5.7 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 5.7 | ||||
| LDTP15664 | Actin-related protein 2/3 complex subunit 1A (ARPC1A) | 5.6 | ||||
| LDTP00202 | AH receptor-interacting protein (AIP) | 5.6 | ||||
| LDTP06892 | Protein Hikeshi (HIKESHI) | 5.5 | ||||
| LDTP04973 | Small ribosomal subunit protein uS14 (RPS29) | 5.4 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 5.4 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 5.3 | ||||
| LDTP03967 | Lamina-associated polypeptide 2, isoform alpha (TMPO) | 5.3 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 5.3 | ||||
| LDTP12746 | Gem-associated protein 8 (GEMIN8) | 5.2 | ||||
| LDTP10263 | KIF-binding protein (KIFBP) | 5.1 | ||||
| LDTP14453 | RNA-binding protein Musashi homolog 1 (MSI1) | 5.1 | ||||
