Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C208 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 44.6 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 30.7 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 24.3 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 23.3 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 22.0 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 21.6 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 20.4 | ||||
| LDTP00282 | Beta-mannosidase (MANBA) | 20.0 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 20.0 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 19.0 | ||||
| LDTP17633 | Beta-galactosidase-1-like protein 2 (GLB1L2) | 18.1 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 17.3 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 16.9 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 14.5 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 14.3 | ||||
| LDTP01372 | Carboxypeptidase D (CPD) | 14.0 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 13.8 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 13.8 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 13.6 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 11.9 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 11.4 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 11.0 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 10.9 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 10.5 | ||||
| LDTP09886 | Gamma-glutamyl hydrolase (GGH) | 9.6 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 9.1 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 8.5 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 7.6 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 7.4 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 6.9 | ||||
| LDTP05346 | Methylmalonate-semialdehyde/malonate-semialdehyde dehydrogenase [acylating], mitochondrial (ALDH6A1) | 6.8 | ||||
| LDTP01333 | Isocitrate dehydrogenase [NADP] cytoplasmic (IDH1) | 6.6 | ||||
| LDTP06370 | Ephrin type-A receptor 7 (EPHA7) | 6.5 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 6.5 | ||||
| LDTP01518 | NADH dehydrogenase 1 alpha subcomplex subunit 7 (NDUFA7) | 6.5 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 6.3 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 6.2 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 6.1 | ||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | 6.0 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 6.0 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 5.9 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 5.7 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 5.3 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 5.1 | ||||
| LDTP03671 | Multidrug resistance-associated protein 1 (ABCC1) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02215 | Prosaposin (PSAP) | 30.7 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 26.5 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 21.7 | ||||
| LDTP02586 | Cation-independent mannose-6-phosphate receptor (IGF2R) | 18.6 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 14.8 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 14.7 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 14.0 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 13.4 | ||||
| LDTP01969 | Transferrin receptor protein 1 (TFRC) | 13.1 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 10.3 | ||||
| LDTP00310 | Syntenin-1 (SDCBP) | 10.2 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 9.6 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 9.2 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 8.9 | ||||
| LDTP03061 | Cation-dependent mannose-6-phosphate receptor (M6PR) | 7.7 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 7.7 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 7.6 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 7.6 | ||||
| LDTP03380 | Stomatin (STOM) | 7.5 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 7.4 | ||||
| LDTP01427 | Slit homolog 2 protein (SLIT2) | 7.2 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 7.0 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 6.6 | ||||
| LDTP02166 | Integrin alpha-V (ITGAV) | 6.6 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 6.3 | ||||
| LDTP00433 | Neuropilin-1 (NRP1) | 6.0 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.7 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 5.4 | ||||
| LDTP04462 | H(+)/Cl(-) exchange transporter 6 (CLCN6) | 5.2 | ||||
| LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 5.1 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 4.9 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01913 | HLA class I histocompatibility antigen, B alpha chain (HLA-B) | 7.8 | ||||
| LDTP02491 | HLA class I histocompatibility antigen, C alpha chain (HLA-C) | 5.9 | ||||
| LDTP14280 | Roundabout homolog 1 (ROBO1) | 5.0 | ||||
| LDTP14203 | Junctional adhesion molecule A (F11R) | 4.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 18.9 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 18.3 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 17.5 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 16.8 | ||||
| LDTP10023 | Lethal(3)malignant brain tumor-like protein 2 (L3MBTL2) | 16.8 | ||||
| LDTP01973 | Ferritin light chain (FTL) | 14.5 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 14.4 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 13.7 | ||||
| LDTP05491 | Amyloid beta precursor like protein 2 (APLP2) | 12.9 | ||||
| LDTP06134 | Protocadherin Fat 1 (FAT1) | 12.2 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 10.8 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 10.1 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 9.2 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 9.0 | ||||
| LDTP05764 | Calcium-binding and coiled-coil domain-containing protein 2 (CALCOCO2) | 8.6 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 8.3 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 7.8 | ||||
| LDTP12352 | CD320 antigen (CD320) | 7.6 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 7.5 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 6.5 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 6.0 | ||||
| LDTP02443 | Calmodulin-3 (CALM3) | 5.8 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 5.7 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 5.2 | ||||
| LDTP13152 | DnaJ homolog subfamily B member 11 (DNAJB11) | 5.1 | ||||
| LDTP00887 | Calumenin (CALU) | 5.1 | ||||
