Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C223 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 37.5 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 30.3 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 22.0 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 21.9 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 21.0 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 19.8 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 18.6 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 18.1 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 16.6 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 16.1 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 16.0 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 15.7 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 14.9 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 14.9 | ||||
| LDTP00282 | Beta-mannosidase (MANBA) | 14.8 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 14.0 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 13.7 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 13.5 | ||||
| LDTP02976 | Peptidyl-glycine alpha-amidating monooxygenase (PAM) | 13.5 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 11.3 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 11.2 | ||||
| LDTP02260 | Beta-glucuronidase (GUSB) | 10.9 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 10.8 | ||||
| LDTP01372 | Carboxypeptidase D (CPD) | 10.8 | ||||
| LDTP02776 | Arylsulfatase A (ARSA) | 10.7 | ||||
| LDTP09886 | Gamma-glutamyl hydrolase (GGH) | 10.1 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 10.0 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 10.0 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 9.9 | ||||
| LDTP13147 | Cathepsin Z (CTSZ) | 9.8 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 9.6 | ||||
| LDTP04452 | N-sulphoglucosamine sulphohydrolase (SGSH) | 9.4 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 9.3 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 8.7 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 8.5 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 7.9 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 7.2 | ||||
| LDTP03858 | Lysosomal acid lipase/cholesteryl ester hydrolase (LIPA) | 6.7 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 5.9 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 5.6 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 5.6 | ||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | 5.5 | ||||
| LDTP05831 | Receptor-type tyrosine-protein phosphatase S (PTPRS) | 5.5 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 23.8 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 23.8 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 22.6 | ||||
| LDTP02215 | Prosaposin (PSAP) | 22.6 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 20.8 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 17.8 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 16.2 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 13.6 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 10.8 | ||||
| LDTP00321 | Podocalyxin (PODXL) | 10.3 | ||||
| LDTP02586 | Cation-independent mannose-6-phosphate receptor (IGF2R) | 10.0 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 9.5 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 9.4 | ||||
| LDTP01829 | Low-density lipoprotein receptor (LDLR) | 9.1 | ||||
| LDTP03380 | Stomatin (STOM) | 8.8 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 8.6 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 8.1 | ||||
| LDTP05538 | Prolow-density lipoprotein receptor-related protein 1 (LRP1) | 7.6 | ||||
| LDTP01969 | Transferrin receptor protein 1 (TFRC) | 7.1 | ||||
| LDTP05218 | Low-density lipoprotein receptor-related protein 2 (LRP2) | 6.9 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 6.6 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 6.3 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 5.9 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 5.8 | ||||
| LDTP02068 | Sodium/potassium-transporting ATPase subunit beta-1 (ATP1B1) | 5.8 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 5.7 | ||||
| LDTP02166 | Integrin alpha-V (ITGAV) | 5.5 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.4 | ||||
| LDTP10731 | Sodium-coupled neutral amino acid symporter 2 (SLC38A2) | 5.2 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 4.9 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12820 | Telomeric repeat-binding factor 2-interacting protein 1 (TERF2IP) | 6.7 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP09907 | Neogenin (NEO1) | 18.5 | ||||
| LDTP04720 | IgG receptor FcRn large subunit p51 (FCGRT) | 16.3 | ||||
| LDTP02040 | HLA class I histocompatibility antigen, A alpha chain (HLA-A) | 5.4 | ||||
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 5.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 21.6 | ||||
| LDTP07703 | Seizure 6-like protein 2 (SEZ6L2) | 17.4 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 14.4 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 13.1 | ||||
| LDTP15115 | Protein GOLM2 (GOLM2) | 12.6 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 12.6 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 10.6 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 9.3 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 9.0 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 7.9 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 7.4 | ||||
| LDTP12352 | CD320 antigen (CD320) | 7.4 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 7.1 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 7.0 | ||||
| LDTP13114 | C-type mannose receptor 2 (MRC2) | 6.8 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 6.6 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 6.5 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 6.2 | ||||
| LDTP00071 | Vacuolar protein sorting-associated protein 37C (VPS37C) | 6.2 | ||||
| LDTP07760 | CD109 antigen (CD109) | 6.1 | ||||
| LDTP11463 | Hyccin (HYCC1) | 6.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 5.9 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 5.6 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 4.9 | ||||
