Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | FFF probe15 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:20uM; negative probe:20uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
SILAC
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 20.0 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 20.0 | ||||
| LDTP01699 | Acyl-CoA 6-desaturase (FADS2) | 20.0 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 20.0 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 20.0 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 20.0 | ||||
| LDTP02198 | Cathepsin D (CTSD) | 20.0 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 20.0 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 20.0 | ||||
| LDTP02651 | Gamma-interferon-inducible lysosomal thiol reductase (IFI30) | 20.0 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 20.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 20.0 | ||||
| LDTP02602 | Histidine--tRNA ligase, cytoplasmic (HARS1) | 20.0 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 20.0 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 20.0 | ||||
| LDTP07504 | Lysophospholipid acyltransferase 5 (LPCAT3) | 20.0 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 20.0 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 20.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 20.0 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 20.0 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 20.0 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 20.0 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 20.0 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 20.0 | ||||
| LDTP03689 | Serine hydroxymethyltransferase, mitochondrial (SHMT2) | 20.0 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 20.0 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 20.0 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 18.2 | ||||
| LDTP02565 | Medium-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADM) | 17.9 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 17.7 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 16.6 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 16.2 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 16.0 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 16.0 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 14.5 | ||||
| LDTP10887 | Synaptic vesicle membrane protein VAT-1 homolog (VAT1) | 14.2 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 14.1 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 13.9 | ||||
| LDTP08979 | Prostaglandin reductase 2 (PTGR2) | 13.1 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 11.2 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 10.4 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 10.4 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 7.6 | ||||
| LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | 7.1 | ||||
| LDTP04251 | Elongation factor Tu, mitochondrial (TUFM) | 5.9 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 5.5 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 5.3 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 20.0 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 20.0 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 20.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 20.0 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 20.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 20.0 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 20.0 | ||||
| LDTP04707 | Protein SEC13 homolog (SEC13) | 16.7 | ||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | 15.0 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 12.6 | ||||
| LDTP09949 | Transportin-1 (TNPO1) | 12.5 | ||||
| LDTP01295 | Nuclear pore complex protein Nup155 (NUP155) | 12.1 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 10.6 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 8.5 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 5.6 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 20.0 | ||||
| LDTP00887 | Calumenin (CALU) | 20.0 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 20.0 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 20.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 20.0 | ||||
| LDTP10078 | Far upstream element-binding protein 1 (FUBP1) | 20.0 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 20.0 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 20.0 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 20.0 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 20.0 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 20.0 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 20.0 | ||||
| LDTP06352 | Reticulocalbin-1 (RCN1) | 20.0 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 20.0 | ||||
| LDTP13630 | Neudesin (NENF) | 19.0 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 13.5 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 13.1 | ||||
| LDTP05012 | Small ribosomal subunit protein eS24 (RPS24) | 12.1 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 5.8 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 5.6 | ||||
| LDTP02297 | Vimentin (VIM) | 5.1 | ||||
