Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C342 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 99.7 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 42.8 | ||||
| LDTP00575 | Glutathione S-transferase A4 (GSTA4) | 34.5 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 27.9 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 26.2 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 21.4 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 20.7 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 18.5 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 14.9 | ||||
| LDTP10709 | Pseudouridylate synthase 7 homolog (PUS7) | 14.6 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 14.1 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 13.3 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 12.4 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 12.3 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 10.5 | ||||
| LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 9.8 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 9.5 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 8.6 | ||||
| LDTP12610 | Obg-like ATPase 1 (OLA1) | 7.9 | ||||
| LDTP03374 | Peptidyl-prolyl cis-trans isomerase FKBP2 (FKBP2) | 7.8 | ||||
| LDTP00325 | Pirin (PIR) | 7.6 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 7.6 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 7.0 | ||||
| LDTP10318 | Ubiquitin thioesterase OTUB1 (OTUB1) | 6.9 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 6.8 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 6.6 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 6.1 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 6.1 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 6.0 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 6.0 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 6.0 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 5.9 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 5.8 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 5.7 | ||||
| LDTP03001 | E3 ubiquitin-protein ligase TRIM21 (TRIM21) | 5.5 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 5.4 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 5.3 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 5.1 | ||||
| LDTP01333 | Isocitrate dehydrogenase [NADP] cytoplasmic (IDH1) | 5.1 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 12.1 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 11.1 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 10.2 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 9.1 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 8.6 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 8.4 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 8.3 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 7.7 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 7.4 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 7.3 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 6.8 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 6.5 | ||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | 6.0 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 6.0 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 5.7 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 5.6 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 5.5 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 5.5 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 5.4 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.4 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 5.2 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 5.0 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 4.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 11.1 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 9.9 | ||||
| LDTP01451 | UBX domain-containing protein 7 (UBXN7) | 9.8 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 9.1 | ||||
| LDTP01075 | Protein CutA (CUTA) | 8.9 | ||||
| LDTP08000 | Dymeclin (DYM) | 8.5 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 7.9 | ||||
| LDTP15714 | Mdm2-binding protein (MTBP) | 7.9 | ||||
| LDTP13630 | Neudesin (NENF) | 7.5 | ||||
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 6.9 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 6.8 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 6.5 | ||||
| LDTP08874 | Mitochondrial intermembrane space import and assembly protein 40 (CHCHD4) | 6.3 | ||||
| LDTP03520 | Phosphatidylethanolamine-binding protein 1 (PEBP1) | 6.3 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 5.8 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 5.4 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 5.3 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 5.1 | ||||
| LDTP12623 | Zinc finger CCHC domain-containing protein 3 (ZCCHC3) | 5.0 | ||||
