Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C171 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 27.7 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 26.0 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 18.4 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 18.0 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 16.3 | ||||
| LDTP02217 | Procathepsin L (CTSL) | 15.6 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 13.6 | ||||
| LDTP00185 | Deoxyribonuclease-2-alpha (DNASE2) | 12.8 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 12.5 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 10.6 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 9.9 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 9.8 | ||||
| LDTP10888 | Legumain (LGMN) | 9.4 | ||||
| LDTP14801 | Di-N-acetylchitobiase (CTBS) | 8.9 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 8.9 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 8.8 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 8.8 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 8.8 | ||||
| LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | 8.6 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 8.6 | ||||
| LDTP00282 | Beta-mannosidase (MANBA) | 8.6 | ||||
| LDTP12135 | Sialate O-acetylesterase (SIAE) | 8.6 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 8.5 | ||||
| LDTP02260 | Beta-glucuronidase (GUSB) | 8.5 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 8.3 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 8.1 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 8.1 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 8.1 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 7.6 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 7.6 | ||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | 7.4 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 7.3 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 7.3 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 7.2 | ||||
| LDTP02976 | Peptidyl-glycine alpha-amidating monooxygenase (PAM) | 6.9 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 6.8 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 6.8 | ||||
| LDTP09886 | Gamma-glutamyl hydrolase (GGH) | 6.6 | ||||
| LDTP02776 | Arylsulfatase A (ARSA) | 6.5 | ||||
| LDTP14305 | Bis(5'-adenosyl)-triphosphatase ENPP4 (ENPP4) | 6.3 | ||||
| LDTP09764 | Acid sphingomyelinase-like phosphodiesterase 3b (SMPDL3B) | 6.3 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 6.1 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 6.0 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 5.6 | ||||
| LDTP03683 | N-acetylgalactosamine-6-sulfatase (GALNS) | 5.2 | ||||
| LDTP02643 | Uracil-DNA glycosylase (UNG) | 5.2 | ||||
| LDTP08933 | Chondroitin sulfate N-acetylgalactosaminyltransferase 2 (CSGALNACT2) | 5.1 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 17.6 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 16.8 | ||||
| LDTP12042 | Proton-activated chloride channel (PACC1) | 14.8 | ||||
| LDTP02215 | Prosaposin (PSAP) | 13.9 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 11.7 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 11.1 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 10.1 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 9.9 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 9.1 | ||||
| LDTP05218 | Low-density lipoprotein receptor-related protein 2 (LRP2) | 8.8 | ||||
| LDTP09838 | Sortilin-related receptor (SORL1) | 8.7 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 7.7 | ||||
| LDTP08327 | Osteopetrosis-associated transmembrane protein 1 (OSTM1) | 7.3 | ||||
| LDTP00321 | Podocalyxin (PODXL) | 7.1 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 6.6 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 6.5 | ||||
| LDTP01829 | Low-density lipoprotein receptor (LDLR) | 6.3 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 6.1 | ||||
| LDTP02586 | Cation-independent mannose-6-phosphate receptor (IGF2R) | 6.0 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 5.7 | ||||
| LDTP01969 | Transferrin receptor protein 1 (TFRC) | 5.5 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 5.1 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04720 | IgG receptor FcRn large subunit p51 (FCGRT) | 7.9 | ||||
Cytokine and receptor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02775 | Interferon gamma receptor 1 (IFNGR1) | 8.5 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01279 | Protein CREG1 (CREG1) | 19.3 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 18.5 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 13.5 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 12.4 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 12.0 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 9.6 | ||||
| LDTP05491 | Amyloid beta precursor like protein 2 (APLP2) | 9.3 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 9.3 | ||||
| LDTP05215 | Very low-density lipoprotein receptor (VLDLR) | 8.9 | ||||
| LDTP07703 | Seizure 6-like protein 2 (SEZ6L2) | 8.8 | ||||
| LDTP11096 | Calsyntenin-3 (CLSTN3) | 8.0 | ||||
| LDTP12352 | CD320 antigen (CD320) | 7.9 | ||||
| LDTP12256 | UPF0606 protein KIAA1549 (KIAA1549) | 7.3 | ||||
| LDTP13114 | C-type mannose receptor 2 (MRC2) | 6.4 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 6.4 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 5.9 | ||||
| LDTP02728 | Nidogen-1 (NID1) | 5.7 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 5.7 | ||||
| LDTP07760 | CD109 antigen (CD109) | 5.6 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 5.4 | ||||
| LDTP13669 | Endothelial protein C receptor (PROCR) | 5.4 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 5.3 | ||||
| LDTP06154 | Desmocollin-3 (DSC3) | 5.2 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 5.1 | ||||
| LDTP01075 | Protein CutA (CUTA) | 5.0 | ||||
