Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C214 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 76.1 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 48.2 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 39.9 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 21.9 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 20.0 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 11.3 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 11.0 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 10.6 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 10.1 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 9.1 | ||||
| LDTP00575 | Glutathione S-transferase A4 (GSTA4) | 8.2 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 7.6 | ||||
| LDTP00645 | Prolyl 4-hydroxylase subunit alpha-2 (P4HA2) | 6.9 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 6.8 | ||||
| LDTP01518 | NADH dehydrogenase 1 alpha subcomplex subunit 7 (NDUFA7) | 6.8 | ||||
| LDTP06320 | [Pyruvate dehydrogenase (acetyl-transferring)] kinase isozyme 1, mitochondrial (PDK1) | 6.6 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 6.5 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 6.3 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 6.3 | ||||
| LDTP01640 | CCR4-NOT transcription complex subunit 4 (CNOT4) | 5.9 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 5.7 | ||||
| LDTP06721 | GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase (ALG11) | 5.7 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 5.7 | ||||
| LDTP11617 | Myotubularin-related protein 12 (MTMR12) | 5.7 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 5.7 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 5.5 | ||||
| LDTP13200 | tRNA (cytidine(32)/guanosine(34)-2'-O)-methyltransferase (FTSJ1) | 5.5 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 5.4 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 28.8 | ||||
| LDTP05662 | Cell division cycle protein 20 homolog (CDC20) | 21.3 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 20.4 | ||||
| LDTP13256 | SUN domain-containing protein 2 (SUN2) | 12.9 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 11.6 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 10.9 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 8.8 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 8.5 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 8.1 | ||||
| LDTP01043 | Sorting nexin-2 (SNX2) | 7.8 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 7.7 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 7.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 7.6 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 6.7 | ||||
| LDTP04259 | Signal recognition particle 9 kDa protein (SRP9) | 6.7 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 6.6 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 6.6 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 6.5 | ||||
| LDTP05236 | Phosphatidylinositol transfer protein alpha isoform (PITPNA) | 6.4 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 6.0 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 5.6 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05065 | Y-box-binding protein 1 (YBX1) | 6.5 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 12.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 11.9 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 11.2 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 9.8 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 8.7 | ||||
| LDTP00620 | Eukaryotic translation initiation factor 3 subunit H (EIF3H) | 8.5 | ||||
| LDTP11995 | WD repeat and coiled-coil-containing protein (WDCP) | 8.5 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 8.4 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 8.2 | ||||
| LDTP00887 | Calumenin (CALU) | 8.0 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 7.0 | ||||
| LDTP13152 | DnaJ homolog subfamily B member 11 (DNAJB11) | 6.8 | ||||
| LDTP11327 | RNA polymerase II-associated protein 1 (RPAP1) | 6.8 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 6.6 | ||||
| LDTP10281 | Cytoplasmic dynein 2 intermediate chain 2 (DYNC2I2) | 6.5 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 6.5 | ||||
| LDTP07132 | Ubiquitin-associated protein 2 (UBAP2) | 6.3 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 6.1 | ||||
| LDTP13630 | Neudesin (NENF) | 6.1 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 6.1 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 6.1 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 5.9 | ||||
| LDTP05277 | Protein SET (SET) | 5.9 | ||||
| LDTP02443 | Calmodulin-3 (CALM3) | 5.9 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 5.9 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 5.7 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 5.6 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 5.6 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 5.5 | ||||
| LDTP12073 | Golgi reassembly-stacking protein 2 (GORASP2) | 5.4 | ||||
| LDTP14058 | Rap guanine nucleotide exchange factor 2 (RAPGEF2) | 5.4 | ||||
