Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | FFF probe9 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:20uM; negative probe:20uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
SILAC
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 20.0 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 20.0 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 20.0 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 20.0 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 20.0 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 20.0 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 20.0 | ||||
| LDTP02198 | Cathepsin D (CTSD) | 20.0 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 20.0 | ||||
| LDTP05171 | Dermcidin (DCD) | 20.0 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 20.0 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 20.0 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 20.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 20.0 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 20.0 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 20.0 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 20.0 | ||||
| LDTP10888 | Legumain (LGMN) | 20.0 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 20.0 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 20.0 | ||||
| LDTP00886 | Nardilysin (NRDC) | 20.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 20.0 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 20.0 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 20.0 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 20.0 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 20.0 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 20.0 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 20.0 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 20.0 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 20.0 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 20.0 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 20.0 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 19.5 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 19.5 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 16.6 | ||||
| LDTP10318 | Ubiquitin thioesterase OTUB1 (OTUB1) | 15.9 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 14.6 | ||||
| LDTP03858 | Lysosomal acid lipase/cholesteryl ester hydrolase (LIPA) | 14.4 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 13.7 | ||||
| LDTP10887 | Synaptic vesicle membrane protein VAT-1 homolog (VAT1) | 12.2 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 8.7 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 8.4 | ||||
| LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | 8.1 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 6.0 | ||||
| LDTP01333 | Isocitrate dehydrogenase [NADP] cytoplasmic (IDH1) | 5.6 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02071 | Amyloid-beta precursor protein (APP) | 20.0 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 20.0 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 20.0 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 20.0 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 20.0 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 20.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 20.0 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 20.0 | ||||
| LDTP12042 | Proton-activated chloride channel (PACC1) | 20.0 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 20.0 | ||||
| LDTP00310 | Syntenin-1 (SDCBP) | 20.0 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 20.0 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 20.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 20.0 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 15.4 | ||||
| LDTP01969 | Transferrin receptor protein 1 (TFRC) | 13.0 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 7.4 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 7.2 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 10.6 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05491 | Amyloid beta precursor like protein 2 (APLP2) | 20.0 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 20.0 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 20.0 | ||||
| LDTP00887 | Calumenin (CALU) | 20.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 20.0 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 20.0 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 20.0 | ||||
| LDTP08425 | Hornerin (HRNR) | 20.0 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 20.0 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 20.0 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 20.0 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 20.0 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 19.9 | ||||
| LDTP13630 | Neudesin (NENF) | 19.6 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 17.2 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 16.7 | ||||
| LDTP02756 | Junction plakoglobin (JUP) | 16.2 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 15.2 | ||||
| LDTP06352 | Reticulocalbin-1 (RCN1) | 12.5 | ||||
| LDTP02297 | Vimentin (VIM) | 5.2 | ||||
