Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C205 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 37.5 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 27.7 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 15.2 | ||||
| LDTP08933 | Chondroitin sulfate N-acetylgalactosaminyltransferase 2 (CSGALNACT2) | 13.7 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 11.7 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 11.5 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 11.2 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 11.1 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 9.8 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 9.5 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 9.1 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 8.8 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 8.0 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 7.8 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 7.8 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 7.6 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 7.6 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 7.5 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 7.5 | ||||
| LDTP03692 | Bifunctional epoxide hydrolase 2 (EPHX2) | 7.4 | ||||
| LDTP12524 | L-aminoadipate-semialdehyde dehydrogenase-phosphopantetheinyl transferase (AASDHPPT) | 6.5 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 5.9 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 5.8 | ||||
| LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | 5.5 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 5.5 | ||||
| LDTP17247 | 5'-nucleotidase domain-containing protein 1 (NT5DC1) | 5.4 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 5.4 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 5.4 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 5.3 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 5.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 5.0 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 11.6 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 11.2 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 10.3 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 9.7 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 9.3 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 9.3 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 8.8 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 8.6 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 8.2 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 8.1 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 7.9 | ||||
| LDTP02215 | Prosaposin (PSAP) | 7.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 7.6 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 7.5 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 6.7 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 6.5 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 5.8 | ||||
| LDTP01969 | Transferrin receptor protein 1 (TFRC) | 5.8 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 5.4 | ||||
| LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 5.3 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.2 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 5.2 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 5.0 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13718 | Zinc finger CCCH domain-containing protein 4 (ZC3H4) | 5.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 13.5 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 13.5 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 11.5 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 11.1 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 10.9 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 8.9 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 8.7 | ||||
| LDTP10255 | Protein Hook homolog 2 (HOOK2) | 7.5 | ||||
| LDTP06068 | MAGUK p55 subfamily member 2 (MPP2) | 7.1 | ||||
| LDTP13630 | Neudesin (NENF) | 6.8 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 6.6 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 5.8 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 5.6 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 5.5 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 5.4 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 5.2 | ||||
| LDTP04396 | RNA-binding protein FXR2 (FXR2) | 5.2 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 5.1 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 5.0 | ||||
