Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C052 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 11.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 7.9 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 7.8 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 7.6 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 7.1 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 7.1 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 6.5 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 6.0 | ||||
| LDTP04552 | Biliverdin reductase A (BLVRA) | 5.9 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 5.9 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 5.9 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 5.8 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 5.7 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 5.2 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 5.1 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 5.0 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 13.9 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 10.9 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 10.4 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 10.0 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 9.1 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 8.5 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 8.3 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 6.2 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 6.1 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 5.9 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 5.9 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 5.7 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 5.4 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 5.4 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 5.3 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 5.2 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 4.9 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 4.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 14.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 12.6 | ||||
| LDTP02351 | Tropomyosin alpha-1 chain (TPM1) | 12.0 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 9.4 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 8.6 | ||||
| LDTP02869 | Stathmin (STMN1) | 8.2 | ||||
| LDTP05068 | Tropomyosin alpha-4 chain (TPM4) | 7.7 | ||||
| LDTP02297 | Vimentin (VIM) | 7.0 | ||||
| LDTP10857 | c-Myc-binding protein (MYCBP) | 6.9 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 6.9 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 6.8 | ||||
| LDTP05224 | RNA-binding protein 10 (RBM10) | 6.4 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 6.3 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 6.3 | ||||
| LDTP14192 | MORF4 family-associated protein 1 (MRFAP1) | 6.2 | ||||
| LDTP05400 | Lamin-B2 (LMNB2) | 6.2 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 5.9 | ||||
| LDTP03545 | Alpha-2-macroglobulin receptor-associated protein (LRPAP1) | 5.7 | ||||
| LDTP00887 | Calumenin (CALU) | 5.7 | ||||
| LDTP08448 | ELKS/Rab6-interacting/CAST family member 1 (ERC1) | 5.7 | ||||
| LDTP01932 | Prelamin-A/C (LMNA) | 5.7 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 5.7 | ||||
| LDTP06352 | Reticulocalbin-1 (RCN1) | 5.4 | ||||
| LDTP01067 | Endothelial differentiation-related factor 1 (EDF1) | 5.4 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 5.4 | ||||
| LDTP11533 | Oxysterol-binding protein-related protein 6 (OSBPL6) | 5.3 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 5.3 | ||||
| LDTP01638 | YEATS domain-containing protein 4 (YEATS4) | 5.2 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 5.2 | ||||
| LDTP03065 | Lamin-B1 (LMNB1) | 5.1 | ||||
| LDTP05277 | Protein SET (SET) | 5.1 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 4.9 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 4.9 | ||||