Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C405 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 20.7 | ||||
| LDTP01329 | Lathosterol oxidase (SC5D) | 18.1 | ||||
| LDTP00076 | Plasmanylethanolamine desaturase 1 (PEDS1) | 16.7 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 16.1 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 11.3 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 9.9 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 9.4 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 8.9 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 8.3 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 7.6 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 7.5 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 7.2 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 7.1 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 6.9 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 6.9 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 6.8 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 6.8 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 6.6 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 6.4 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 6.2 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 5.9 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 5.8 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 5.6 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 5.5 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 5.4 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 5.4 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 5.3 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 5.3 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 5.2 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 5.1 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 31.6 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 21.7 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 15.5 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 12.9 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 10.9 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 10.1 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 10.1 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 9.6 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 9.5 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 9.3 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 8.6 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 8.2 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 7.8 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 7.6 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 7.3 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 6.7 | ||||
| LDTP02215 | Prosaposin (PSAP) | 6.3 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 6.2 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 6.0 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 5.6 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 5.5 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 5.5 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 5.4 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 5.4 | ||||
Cytokine and receptor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02775 | Interferon gamma receptor 1 (IFNGR1) | 11.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 38.1 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 19.2 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 18.6 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 13.8 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 12.8 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 12.1 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 12.0 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 9.4 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 9.1 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 8.8 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 7.4 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 7.4 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 7.0 | ||||
| LDTP04914 | Large ribosomal subunit protein uL24 (RPL26) | 5.7 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 5.6 | ||||
| LDTP06154 | Desmocollin-3 (DSC3) | 5.1 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 5.1 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 5.0 | ||||
