Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C396 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 28.6 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 15.7 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 15.0 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 14.3 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 11.4 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 11.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 9.6 | ||||
| LDTP02222 | Bifunctional glutamate/proline--tRNA ligase (EPRS1) | 9.3 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 8.8 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 8.4 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 8.2 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 7.4 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 7.2 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 6.5 | ||||
| LDTP00325 | Pirin (PIR) | 6.4 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 6.2 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 6.1 | ||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | 6.0 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 5.9 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 5.9 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 5.8 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 5.5 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 5.5 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 5.4 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 5.3 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 5.3 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 5.2 | ||||
| LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | 5.2 | ||||
| LDTP06501 | Ras-related protein Rab-11B (RAB11B) | 5.1 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 5.0 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 5.0 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 21.4 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 16.0 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 12.8 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 9.3 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 8.9 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 8.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 8.6 | ||||
| LDTP03546 | Translocator protein (TSPO) | 7.7 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 6.9 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 6.5 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 6.4 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 6.0 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 5.9 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 5.7 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 5.7 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.5 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 5.3 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 5.3 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 5.2 | ||||
| LDTP06198 | Major facilitator superfamily domain-containing protein 10 (MFSD10) | 5.2 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 5.1 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 5.1 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 4.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 31.3 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 26.2 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 10.9 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 8.3 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 7.7 | ||||
| LDTP13630 | Neudesin (NENF) | 7.5 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 7.2 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 6.3 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 6.1 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 5.4 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 5.3 | ||||