Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C425 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02223 | Cathepsin B (CTSB) | 47.2 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 31.3 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 26.4 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 25.1 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 23.3 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 22.6 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 22.5 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 22.3 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 20.7 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 20.4 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 20.4 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 19.2 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 18.5 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 17.9 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 17.9 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 17.4 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 16.9 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 15.1 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 13.5 | ||||
| LDTP09886 | Gamma-glutamyl hydrolase (GGH) | 13.5 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 11.8 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 11.4 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 11.1 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 11.1 | ||||
| LDTP00282 | Beta-mannosidase (MANBA) | 10.8 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 10.7 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 10.5 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 10.5 | ||||
| LDTP01372 | Carboxypeptidase D (CPD) | 10.2 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 9.5 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 8.6 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 8.5 | ||||
| LDTP00482 | Peripheral plasma membrane protein CASK (CASK) | 7.6 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 7.1 | ||||
| LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | 7.1 | ||||
| LDTP02260 | Beta-glucuronidase (GUSB) | 6.9 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 5.8 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 5.4 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02215 | Prosaposin (PSAP) | 20.1 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 19.2 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 16.3 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 15.9 | ||||
| LDTP02586 | Cation-independent mannose-6-phosphate receptor (IGF2R) | 14.5 | ||||
| LDTP01969 | Transferrin receptor protein 1 (TFRC) | 13.6 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 13.4 | ||||
| LDTP10885 | Sortilin (SORT1) | 13.0 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 11.5 | ||||
| LDTP05538 | Prolow-density lipoprotein receptor-related protein 1 (LRP1) | 10.9 | ||||
| LDTP00321 | Podocalyxin (PODXL) | 10.6 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 10.4 | ||||
| LDTP04612 | Voltage-dependent calcium channel subunit alpha-2/delta-1 (CACNA2D1) | 9.0 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 8.9 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 8.9 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 8.5 | ||||
| LDTP01427 | Slit homolog 2 protein (SLIT2) | 7.3 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 7.1 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 7.1 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 5.4 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 5.3 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 5.3 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04720 | IgG receptor FcRn large subunit p51 (FCGRT) | 18.5 | ||||
| LDTP02040 | HLA class I histocompatibility antigen, A alpha chain (HLA-A) | 10.0 | ||||
| LDTP01913 | HLA class I histocompatibility antigen, B alpha chain (HLA-B) | 9.5 | ||||
| LDTP02491 | HLA class I histocompatibility antigen, C alpha chain (HLA-C) | 5.6 | ||||
| LDTP14203 | Junctional adhesion molecule A (F11R) | 5.1 | ||||
Cytokine and receptor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02775 | Interferon gamma receptor 1 (IFNGR1) | 21.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05491 | Amyloid beta precursor like protein 2 (APLP2) | 32.0 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 22.6 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 15.8 | ||||
| LDTP01075 | Protein CutA (CUTA) | 13.4 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 11.2 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 11.2 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 10.3 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 7.3 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 6.2 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 6.1 | ||||
| LDTP09054 | Golgi membrane protein 1 (GOLM1) | 6.0 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 5.6 | ||||
