Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C281 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02223 | Cathepsin B (CTSB) | 14.8 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 12.8 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 12.0 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 12.0 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 11.5 | ||||
| LDTP01372 | Carboxypeptidase D (CPD) | 10.9 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 10.9 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 10.9 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 10.7 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 10.6 | ||||
| LDTP05561 | Lactadherin (MFGE8) | 10.6 | ||||
| LDTP14801 | Di-N-acetylchitobiase (CTBS) | 9.6 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 8.8 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 8.8 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 8.6 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 8.5 | ||||
| LDTP10888 | Legumain (LGMN) | 8.5 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 8.4 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 8.2 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 7.9 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 7.9 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 7.0 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 6.9 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 6.9 | ||||
| LDTP02976 | Peptidyl-glycine alpha-amidating monooxygenase (PAM) | 6.9 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 6.8 | ||||
| LDTP12135 | Sialate O-acetylesterase (SIAE) | 6.8 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 6.5 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 6.4 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 6.1 | ||||
| LDTP09886 | Gamma-glutamyl hydrolase (GGH) | 6.1 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 6.0 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 5.7 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 5.5 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 5.5 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 5.5 | ||||
| LDTP00804 | E3 ubiquitin-protein ligase RNF13 (RNF13) | 5.2 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 5.1 | ||||
| LDTP13287 | A disintegrin and metalloproteinase with thrombospondin motifs 1 (ADAMTS1) | 5.0 | ||||
| LDTP08352 | Histone-arginine methyltransferase CARM1 (CARM1) | 5.0 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 5.0 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12042 | Proton-activated chloride channel (PACC1) | 23.8 | ||||
| LDTP10885 | Sortilin (SORT1) | 14.7 | ||||
| LDTP02215 | Prosaposin (PSAP) | 14.0 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 12.8 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 12.4 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 12.1 | ||||
| LDTP05218 | Low-density lipoprotein receptor-related protein 2 (LRP2) | 11.9 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 10.9 | ||||
| LDTP02586 | Cation-independent mannose-6-phosphate receptor (IGF2R) | 10.3 | ||||
| LDTP01969 | Transferrin receptor protein 1 (TFRC) | 10.1 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 9.9 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 8.5 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 7.4 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 6.8 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 6.4 | ||||
| LDTP01427 | Slit homolog 2 protein (SLIT2) | 6.4 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 5.9 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.5 | ||||
| LDTP12738 | Ceroid-lipofuscinosis neuronal protein 6 (CLN6) | 5.1 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 4.9 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP09907 | Neogenin (NEO1) | 10.3 | ||||
| LDTP11441 | Cell adhesion molecule 1 (CADM1) | 6.2 | ||||
| LDTP04020 | Cell surface glycoprotein MUC18 (MCAM) | 5.5 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP07703 | Seizure 6-like protein 2 (SEZ6L2) | 16.0 | ||||
| LDTP15115 | Protein GOLM2 (GOLM2) | 15.6 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 14.5 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 12.4 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 12.0 | ||||
| LDTP05491 | Amyloid beta precursor like protein 2 (APLP2) | 11.2 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 10.6 | ||||
| LDTP06154 | Desmocollin-3 (DSC3) | 9.3 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 8.8 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 8.5 | ||||
| LDTP06121 | Caprin-1 (CAPRIN1) | 7.7 | ||||
| LDTP13114 | C-type mannose receptor 2 (MRC2) | 7.0 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 6.9 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 6.8 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 5.6 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 5.0 | ||||
