Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C428 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 19.6 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 19.4 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 15.3 | ||||
| LDTP03965 | Enoyl-CoA delta isomerase 1, mitochondrial (ECI1) | 11.1 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 10.9 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 9.8 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 8.6 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 8.2 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 7.9 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 7.9 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 7.8 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 7.6 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 7.6 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 7.4 | ||||
| LDTP12673 | 4'-phosphopantetheine phosphatase (PANK4) | 7.1 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 7.1 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 7.0 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 6.7 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 6.3 | ||||
| LDTP04247 | Protein farnesyltransferase subunit beta (FNTB) | 6.1 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 6.1 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 5.8 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 5.8 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 5.7 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 5.5 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 5.2 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 5.2 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 5.2 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 5.2 | ||||
| LDTP12743 | Histone PARylation factor 1 (HPF1) | 5.1 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 5.1 | ||||
| LDTP01707 | Thioredoxin domain-containing protein 12 (TXNDC12) | 5.1 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 5.1 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 5.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 5.0 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03546 | Translocator protein (TSPO) | 34.8 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 16.1 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 16.0 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 12.7 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 11.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 11.0 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 8.6 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 8.6 | ||||
| LDTP09261 | Major facilitator superfamily domain-containing protein 8 (MFSD8) | 8.4 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 8.1 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 7.8 | ||||
| LDTP00298 | Importin subunit alpha-4 (KPNA3) | 7.1 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 6.6 | ||||
| LDTP00328 | Importin subunit alpha-3 (KPNA4) | 5.9 | ||||
| LDTP04502 | Importin subunit alpha-5 (KPNA1) | 5.9 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 5.7 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.5 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 5.4 | ||||
| LDTP07063 | Hippocampus abundant transcript-like protein 1 (MFSD14B) | 5.3 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 5.2 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 5.2 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 5.0 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 4.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03520 | Phosphatidylethanolamine-binding protein 1 (PEBP1) | 22.8 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 20.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 18.9 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 18.1 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 16.2 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 8.1 | ||||
| LDTP01075 | Protein CutA (CUTA) | 6.9 | ||||
| LDTP13630 | Neudesin (NENF) | 6.5 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 5.8 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 5.3 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 5.2 | ||||
| LDTP04395 | RNA-binding protein FXR1 (FXR1) | 5.2 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 5.1 | ||||