Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C204 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP08933 | Chondroitin sulfate N-acetylgalactosaminyltransferase 2 (CSGALNACT2) | 92.4 | ||||
| LDTP02868 | Fumarylacetoacetase (FAH) | 30.3 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 20.4 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 20.3 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 16.6 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 11.9 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 10.1 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 9.8 | ||||
| LDTP02565 | Medium-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADM) | 9.8 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 9.8 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 9.3 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 8.6 | ||||
| LDTP08084 | BRCA1-associated protein (BRAP) | 8.6 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 8.1 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 7.9 | ||||
| LDTP07503 | Endoplasmic reticulum aminopeptidase 2 (ERAP2) | 7.8 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 7.4 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 7.2 | ||||
| LDTP12679 | Trimethyllysine dioxygenase, mitochondrial (TMLHE) | 7.1 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 6.9 | ||||
| LDTP06432 | Pachytene checkpoint protein 2 homolog (TRIP13) | 6.2 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 6.1 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 5.6 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 5.6 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 5.5 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 5.5 | ||||
| LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | 5.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 5.0 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 19.3 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 18.1 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 13.8 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 12.1 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 11.2 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 8.5 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 8.5 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 8.2 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 8.0 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 7.9 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 7.8 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 7.1 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 6.2 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 6.1 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 6.1 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 5.9 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 5.6 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 5.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 16.7 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 10.9 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 10.6 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 10.0 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 9.7 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 8.2 | ||||
| LDTP12629 | T-complex protein 11-like protein 1 (TCP11L1) | 8.1 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 6.8 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 5.7 | ||||
| LDTP01075 | Protein CutA (CUTA) | 5.7 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 5.7 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 5.4 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 5.4 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 5.2 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 5.0 | ||||