Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C320 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 11.2 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 9.6 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 9.2 | ||||
| LDTP08979 | Prostaglandin reductase 2 (PTGR2) | 8.8 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 8.1 | ||||
| LDTP02868 | Fumarylacetoacetase (FAH) | 7.4 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 7.1 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 7.1 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 7.1 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 7.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 6.9 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 6.7 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 6.7 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 6.5 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 6.5 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 6.4 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 6.3 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 6.1 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 6.1 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 6.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 5.8 | ||||
| LDTP03671 | Multidrug resistance-associated protein 1 (ABCC1) | 5.8 | ||||
| LDTP04246 | Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha (FNTA) | 5.7 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 5.6 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 5.4 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 5.4 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 5.3 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 19.7 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 15.2 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 14.5 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 14.0 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 8.9 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 8.1 | ||||
| LDTP14068 | Cysteine protease ATG4B (ATG4B) | 8.1 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 7.3 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 7.2 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 6.6 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 6.5 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 6.0 | ||||
| LDTP10513 | Exocyst complex component 2 (EXOC2) | 5.9 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 5.7 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.6 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 5.5 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP08081 | Hepatoma-derived growth factor-related protein 2 (HDGFL2) | 34.3 | ||||
| LDTP04483 | Hepatoma-derived growth factor (HDGF) | 16.8 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 14.3 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 10.8 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 10.6 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 10.3 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 10.2 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 9.6 | ||||
| LDTP01233 | PC4 and SFRS1-interacting protein (PSIP1) | 8.6 | ||||
| LDTP02345 | Retinol-binding protein 1 (RBP1) | 8.0 | ||||
| LDTP04558 | Arfaptin-1 (ARFIP1) | 6.5 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 6.4 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 6.4 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 6.4 | ||||
| LDTP13630 | Neudesin (NENF) | 6.1 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 6.1 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 5.9 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 5.8 | ||||
| LDTP06255 | GTPase-activating protein and VPS9 domain-containing protein 1 (GAPVD1) | 5.6 | ||||
| LDTP14000 | Rab GTPase-activating protein 1 (RABGAP1) | 5.6 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 5.5 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 5.4 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 5.4 | ||||
| LDTP17715 | S1 RNA-binding domain-containing protein 1 (SRBD1) | 5.4 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 5.2 | ||||