Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C245 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 21.4 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 17.6 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 11.8 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 9.8 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 9.3 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 8.9 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 8.5 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 7.5 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 6.6 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 6.6 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 6.2 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 5.9 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 5.8 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 5.5 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 5.4 | ||||
| LDTP01389 | Delta(14)-sterol reductase TM7SF2 (TM7SF2) | 5.3 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 5.1 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 23.9 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 23.6 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 20.0 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 18.3 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 17.5 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 17.1 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 16.8 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 15.6 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 14.8 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 13.3 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 12.4 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 11.6 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 11.0 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 10.6 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 9.1 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 8.8 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 8.1 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 8.0 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 6.5 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 6.5 | ||||
| LDTP05667 | Syntaxin-4 (STX4) | 5.4 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 5.2 | ||||
| LDTP02215 | Prosaposin (PSAP) | 5.0 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 5.0 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 4.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12025 | UPF0488 protein C8orf33 (C8orf33) | 23.8 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 17.8 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 16.2 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 16.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 14.8 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 12.7 | ||||
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 10.7 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 10.5 | ||||
| LDTP06868 | Angiomotin (AMOT) | 10.2 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 9.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 7.9 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 7.6 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 7.2 | ||||
| LDTP06068 | MAGUK p55 subfamily member 2 (MPP2) | 6.8 | ||||
| LDTP11420 | Oxysterol-binding protein-related protein 1 (OSBPL1A) | 6.1 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 6.0 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 5.8 | ||||
| LDTP09870 | Signal transducing adapter molecule 1 (STAM) | 5.5 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 5.4 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 5.2 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 4.9 | ||||