Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C271 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 22.8 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 14.9 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 14.7 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 14.7 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 12.0 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 9.3 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 9.3 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 8.3 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 8.2 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 7.7 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 7.7 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 7.6 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 7.5 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 7.4 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 7.4 | ||||
| LDTP04144 | Cytochrome b-c1 complex subunit Rieske, mitochondrial (UQCRFS1) | 7.2 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 7.0 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 6.5 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 6.4 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 6.3 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 6.1 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 5.8 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 5.5 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 5.2 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 5.2 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 5.2 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 5.1 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 5.1 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 4.9 | ||||
| LDTP03730 | Sepiapterin reductase (SPR) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05900 | Metaxin-1 (MTX1) | 12.5 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 9.3 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 8.8 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 8.1 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 7.8 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 7.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 7.4 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 6.6 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 5.8 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 5.7 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 5.6 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 5.6 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 5.4 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 5.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 10.0 | ||||
| LDTP00513 | Plexin-B2 (PLXNB2) | 9.6 | ||||
| LDTP08000 | Dymeclin (DYM) | 8.9 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 8.7 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 7.6 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 6.7 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 5.7 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 5.1 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 5.1 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 5.1 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 5.1 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 5.1 | ||||