Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C251 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 64.0 | ||||
| LDTP09495 | Probable glutathione peroxidase 8 (GPX8) | 58.5 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 57.3 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 56.9 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 53.1 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 52.7 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 48.5 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 47.8 | ||||
| LDTP11268 | Acireductone dioxygenase (ADI1) | 44.0 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 40.5 | ||||
| LDTP08322 | Valacyclovir hydrolase (BPHL) | 40.2 | ||||
| LDTP07591 | Neutral cholesterol ester hydrolase 1 (NCEH1) | 37.0 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 36.3 | ||||
| LDTP04358 | Carnitine O-palmitoyltransferase 1, liver isoform (CPT1A) | 35.0 | ||||
| LDTP00701 | D-3-phosphoglycerate dehydrogenase (PHGDH) | 32.0 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 31.8 | ||||
| LDTP06626 | Hydroxyacylglutathione hydrolase, mitochondrial (HAGH) | 30.5 | ||||
| LDTP06721 | GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase (ALG11) | 29.0 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 28.2 | ||||
| LDTP06657 | 2-hydroxyacylsphingosine 1-beta-galactosyltransferase (UGT8) | 28.1 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 28.1 | ||||
| LDTP15132 | 2-oxoglutarate and iron-dependent oxygenase domain-containing protein 3 (OGFOD3) | 27.5 | ||||
| LDTP09000 | Lysophospholipase D GDPD1 (GDPD1) | 26.9 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 25.8 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 69.1 | ||||
| LDTP06633 | Reticulon-1 (RTN1) | 57.3 | ||||
| LDTP01060 | PRA1 family protein 2 (PRAF2) | 49.5 | ||||
| LDTP00127 | Nuclear envelope pore membrane protein POM 121C (POM121C) | 39.9 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 39.4 | ||||
| LDTP01454 | SUN domain-containing protein 1 (SUN1) | 34.5 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 32.9 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 30.5 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 29.4 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 29.0 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 28.2 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11441 | Cell adhesion molecule 1 (CADM1) | 27.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01522 | Reticulon-3 (RTN3) | 59.3 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 51.3 | ||||
| LDTP05011 | Small ribosomal subunit protein uS19 (RPS15) | 40.8 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 38.6 | ||||
| LDTP05257 | Receptor expression-enhancing protein 5 (REEP5) | 37.0 | ||||
| LDTP09970 | RNA-binding protein with multiple splicing (RBPMS) | 36.8 | ||||
| LDTP17157 | OCIA domain-containing protein 2 (OCIAD2) | 35.3 | ||||
| LDTP16049 | Large ribosomal subunit protein uL29m (MRPL47) | 30.9 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 29.2 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 29.0 | ||||
| LDTP16078 | Heme-binding protein 1 (HEBP1) | 27.9 | ||||
| LDTP14787 | Small ribosomal subunit protein mS25 (MRPS25) | 27.7 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 26.2 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 25.8 | ||||