Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C060 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 35.3 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 15.2 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 14.9 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 12.0 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 8.5 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 8.2 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 7.9 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 7.5 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 7.4 | ||||
| LDTP07620 | Peroxisomal N(1)-acetyl-spermine/spermidine oxidase (PAOX) | 6.8 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 6.7 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 6.6 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 6.4 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 6.2 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 5.7 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 5.4 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 5.1 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 5.1 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 5.1 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 22.3 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 11.2 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 11.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 10.9 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 9.8 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 8.7 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 7.9 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 7.6 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 7.5 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 7.0 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 6.6 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 6.3 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 5.9 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 5.7 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.6 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 32.9 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 14.5 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 12.5 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 10.6 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 9.1 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 8.8 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 7.0 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 6.7 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 6.4 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 5.9 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 5.3 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 5.2 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 5.0 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 5.0 | ||||