Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C138 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 21.9 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 16.0 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 13.0 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 9.9 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 9.1 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 9.1 | ||||
| LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 7.8 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 6.1 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 5.9 | ||||
| LDTP01419 | Retinal dehydrogenase 2 (ALDH1A2) | 5.6 | ||||
| LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | 5.4 | ||||
| LDTP00645 | Prolyl 4-hydroxylase subunit alpha-2 (P4HA2) | 5.3 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 5.2 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 5.2 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 5.2 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 5.2 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 5.1 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 5.0 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 31.3 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 8.1 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 7.7 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 7.4 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 6.9 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 6.4 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 6.1 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 5.9 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 5.7 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 5.7 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 5.6 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 5.5 | ||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | 5.3 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 5.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15623 | Neuferricin (CYB5D2) | 22.5 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 10.5 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 8.9 | ||||
| LDTP11533 | Oxysterol-binding protein-related protein 6 (OSBPL6) | 8.0 | ||||
| LDTP06072 | Dedicator of cytokinesis protein 1 (DOCK1) | 7.4 | ||||
| LDTP00376 | Coatomer subunit epsilon (COPE) | 7.3 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 6.5 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 5.8 | ||||
| LDTP13630 | Neudesin (NENF) | 5.6 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 5.2 | ||||
| LDTP04626 | UV excision repair protein RAD23 homolog A (RAD23A) | 5.1 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 5.1 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 5.0 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 5.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 5.0 | ||||
| LDTP01075 | Protein CutA (CUTA) | 5.0 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 4.9 | ||||