Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C360 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 22.6 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 15.7 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 15.7 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 15.0 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 14.2 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 13.2 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 12.6 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 12.0 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 10.4 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 9.4 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 9.3 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 8.4 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 7.0 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 6.9 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 6.8 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 6.6 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 6.1 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 5.9 | ||||
| LDTP01515 | NADH dehydrogenase 1 beta subcomplex subunit 8, mitochondrial (NDUFB8) | 5.7 | ||||
| LDTP04253 | Alpha-aminoadipic semialdehyde dehydrogenase (ALDH7A1) | 5.7 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 5.3 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 5.1 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 25.6 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 22.9 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 15.8 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 12.3 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 12.3 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 8.0 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 7.3 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 6.6 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 6.0 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 5.2 | ||||
| LDTP03546 | Translocator protein (TSPO) | 5.0 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 12.7 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 11.7 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 9.0 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 8.2 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 7.4 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 5.9 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 5.4 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 5.4 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 5.1 | ||||
| LDTP11533 | Oxysterol-binding protein-related protein 6 (OSBPL6) | 5.0 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 5.0 | ||||