Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C131 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP06839 | NAD kinase 2, mitochondrial (NADK2) | 23.9 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 22.0 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 17.4 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 16.7 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 15.6 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 10.6 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 7.9 | ||||
| LDTP08979 | Prostaglandin reductase 2 (PTGR2) | 7.8 | ||||
| LDTP04289 | Very long-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADVL) | 7.6 | ||||
| LDTP00538 | Inhibitor of nuclear factor kappa-B kinase subunit alpha (CHUK) | 7.5 | ||||
| LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 7.3 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 7.0 | ||||
| LDTP11437 | Peroxisomal trans-2-enoyl-CoA reductase (PECR) | 7.0 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 6.4 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 6.3 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 6.1 | ||||
| LDTP11209 | Phosphatidylinositol 4-kinase type 2-alpha (PI4K2A) | 6.1 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 5.6 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 5.5 | ||||
| LDTP11494 | Neurolysin, mitochondrial (NLN) | 5.5 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 5.3 | ||||
| LDTP13409 | Anaphase-promoting complex subunit 7 (ANAPC7) | 5.1 | ||||
| LDTP02260 | Beta-glucuronidase (GUSB) | 4.9 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 7.2 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 6.8 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 5.4 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 5.4 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05065 | Y-box-binding protein 1 (YBX1) | 6.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15623 | Neuferricin (CYB5D2) | 24.3 | ||||
| LDTP14250 | Cytoplasmic dynein 1 light intermediate chain 1 (DYNC1LI1) | 14.1 | ||||
| LDTP00887 | Calumenin (CALU) | 13.0 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 12.6 | ||||
| LDTP13630 | Neudesin (NENF) | 9.9 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 9.6 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 5.6 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 5.6 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 5.5 | ||||
| LDTP06352 | Reticulocalbin-1 (RCN1) | 5.5 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 5.4 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 5.2 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 5.2 | ||||
| LDTP13152 | DnaJ homolog subfamily B member 11 (DNAJB11) | 4.9 | ||||