Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C018 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 12.8 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 11.6 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 10.9 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 9.3 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 8.3 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 7.8 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 6.2 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 5.9 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 5.9 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 5.8 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 5.6 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 5.6 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 5.5 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 5.4 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 5.3 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 5.3 | ||||
| LDTP00559 | Transcription intermediary factor 1-alpha (TRIM24) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 13.0 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 10.8 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 9.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 8.1 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 7.4 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 6.5 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 5.2 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 5.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 10.6 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 8.5 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 7.6 | ||||
| LDTP10469 | Engulfment and cell motility protein 2 (ELMO2) | 6.6 | ||||
| LDTP02205 | Tubulin beta chain (TUBB) | 6.4 | ||||
| LDTP05998 | Tubulin beta-2A chain (TUBB2A) | 6.4 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 5.9 | ||||
| LDTP17652 | Uncharacterized protein KIAA2013 (KIAA2013) | 5.7 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 5.2 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 5.0 | ||||