Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C414 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 31.1 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 18.3 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 14.1 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 14.1 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 13.8 | ||||
| LDTP01141 | E3 ubiquitin-protein ligase BRE1B (RNF40) | 11.6 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 9.6 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 9.0 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 7.5 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 7.2 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 6.1 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 6.0 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 5.8 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 5.3 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 5.2 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 5.2 | ||||
| LDTP03001 | E3 ubiquitin-protein ligase TRIM21 (TRIM21) | 5.2 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 16.9 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 15.1 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 14.9 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 9.5 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 7.2 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 6.7 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 5.4 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 5.2 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 11.6 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 11.0 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 7.8 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 5.6 | ||||