Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C344 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00575 | Glutathione S-transferase A4 (GSTA4) | 18.6 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 16.2 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 14.1 | ||||
| LDTP04737 | DNA polymerase epsilon subunit 2 (POLE2) | 10.3 | ||||
| LDTP01641 | STAM-binding protein (STAMBP) | 9.3 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 8.2 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 7.7 | ||||
| LDTP01759 | Histone-lysine N-methyltransferase NSD2 (NSD2) | 6.9 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 5.9 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 5.9 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 5.7 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 5.6 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 5.4 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 5.4 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 5.2 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 5.2 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 5.1 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 8.9 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 8.3 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 5.9 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 5.5 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 5.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 15.9 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 7.6 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 6.9 | ||||
| LDTP11328 | Splicing factor 3B subunit 5 (SF3B5) | 6.5 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 5.9 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 5.4 | ||||
| LDTP06154 | Desmocollin-3 (DSC3) | 5.3 | ||||
| LDTP02526 | Clusterin (CLU) | 5.0 | ||||
| LDTP17808 | SHC SH2 domain-binding protein 1 (SHCBP1) | 4.9 | ||||