Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C006 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 15.0 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 10.1 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 9.9 | ||||
| LDTP06227 | Prostaglandin reductase 1 (PTGR1) | 9.7 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 8.7 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 8.5 | ||||
| LDTP08565 | E3 ubiquitin-protein ligase UBR2 (UBR2) | 6.4 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 6.3 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 6.3 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 6.2 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 6.1 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 5.9 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 5.3 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 5.1 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 26.4 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 17.8 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 8.2 | ||||
| LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 6.5 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 6.3 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 5.7 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 5.4 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 5.4 | ||||
| LDTP05384 | Mitochondrial 2-oxoglutarate/malate carrier protein (SLC25A11) | 5.2 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 5.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 8.4 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 6.3 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 5.4 | ||||