Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C002 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP09031 | Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 (POMGNT2) | 28.6 | ||||
| LDTP04529 | 2-iminobutanoate/2-iminopropanoate deaminase (RIDA) | 12.4 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 11.4 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 10.6 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 9.1 | ||||
| LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 8.6 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 6.9 | ||||
| LDTP12505 | CTP synthase 2 (CTPS2) | 6.9 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 6.6 | ||||
| LDTP12670 | SET domain-containing protein 4 (SETD4) | 6.4 | ||||
| LDTP10215 | Carboxymethylenebutenolidase homolog (CMBL) | 5.8 | ||||
| LDTP00479 | Histone acetyltransferase type B catalytic subunit (HAT1) | 5.6 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 5.4 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 57.3 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 6.6 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 6.6 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 6.5 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 5.9 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 5.3 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 5.1 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 5.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 12.4 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 10.4 | ||||
| LDTP03520 | Phosphatidylethanolamine-binding protein 1 (PEBP1) | 10.4 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 7.8 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 6.9 | ||||
| LDTP13630 | Neudesin (NENF) | 6.9 | ||||
| LDTP12395 | Large ribosomal subunit protein mL40 (MRPL40) | 6.5 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 6.2 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 5.1 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 5.0 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 5.0 | ||||